Introduction：Basic information about 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone CAS 131-54-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,2'-Dihydroxy-4,4'-dimethoxybenzophenone Basic information
| Product Name: | 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone |
| Synonyms: | Benzophenone, 2,2'-dihydroxy-4,4'-dimethoxy-;bis(2-hydroxy-4-methoxyphenyl)-methanon;Cyasorb UV 12;2,2-DIHDROXY-4,4-DIMETHOXYBENZOPHENONE;UV-6,BP-6;UV absorber UV BP-6;2,2'-Dihydroxy-4,4'-dimethoxybenzophenone≥99%;BENZOPHENONE-6 |
| CAS: | 131-54-4 |
| MF: | C15H14O5 |
| MW: | 274.27 |
| EINECS: | 205-027-3 |
| Product Categories: | Aromatic Benzophenones & Derivatives (substituted);INORGANIC & ORGANIC CHEMICALS;Benzophenones (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Polymer Additives;Polymer Science;Stabilizers |
| Mol File: | 131-54-4.mol |
|
2,2'-Dihydroxy-4,4'-dimethoxybenzophenone Chemical Properties
| Melting point | 133-136 °C(lit.) |
| Boiling point | 377.26°C (rough estimate) |
| density | 1.2662 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | 6.81±0.35(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | negligible |
| Merck | 14,1099 |
| BRN | 1887087 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | FRAGRANCE
UV ABSORBER |
| Cosmetic Ingredient Review (CIR) | 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone (131-54-4) |
| InChI | 1S/C15H14O5/c1-19-9-3-5-11(13(16)7-9)15(18)12-6-4-10(20-2)8-14(12)17/h3-8,16-17H,1-2H3 |
| InChIKey | SODJJEXAWOSSON-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(O)c1)C(=O)c2ccc(OC)cc2O |
| LogP | 3.9-4.1 |
| CAS DataBase Reference | 131-54-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone(131-54-4) |
| EPA Substance Registry System | Methanone, bis(2-hydroxy-4-methoxyphenyl)- (131-54-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-22 |
| WGK Germany | 3 |
| RTECS | DJ0900000 |
| TSCA | TSCA listed |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
| Hazardous Substances Data | 131-54-4(Hazardous Substances Data) |
2,2'-Dihydroxy-4,4'-dimethoxybenzophenone Usage And Synthesis
| Chemical Properties | Yellow crystalline powder |
| Uses | As ultraviolet light absorber, especially in paints, plastics. |
| Preparation | preparation by reaction of 2-hydroxy-4-methoxy-benzoic acid with resorcinol monomethyl ether in the presence of zinc chloride and phosphorous oxychloride at 7075° for 2. |
2,2'-Dihydroxy-4,4'-dimethoxybenzophenone Preparation Products And Raw materials
| Raw materials | 1,3-Dimethoxybenzene |
