Introduction：Basic information about 2,2'-Dinaphthyl Ether CAS 613-80-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,2'-Dinaphthyl Ether Basic information
| Product Name: | 2,2'-Dinaphthyl Ether |
| Synonyms: | 2-naphthalen-2-yloxynaphthalene;2,2'-oxydinaphthalene;Di-beta-naphthyl ether;2,2'-DINAPHTHYL ETHER;2-(2-Naphthyloxy)naphthalene;Naphthalene, 2,2'-oxybis-;di-2-naphthyl ether;Dinaphthol |
| CAS: | 613-80-9 |
| MF: | C20H14O |
| MW: | 270.33 |
| EINECS: | 210-356-0 |
| Product Categories: | |
| Mol File: | 613-80-9.mol |
|
2,2'-Dinaphthyl Ether Chemical Properties
| Melting point | 105°C |
| Boiling point | 250 °C / 19mmHg |
| density | 1.0717 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Beige |
| BRN | 2054097 |
| InChI | InChI=1S/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| InChIKey | DZRLNYVDCIYXPG-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C2C(=C1)C=CC=C2)C1=CC=C2C(=C1)C=CC=C2 |
| CAS DataBase Reference | 613-80-9(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| HS Code | 29029090 |
2,2'-Dinaphthyl Ether Usage And Synthesis
| Uses | 2,2''-Dinaphthyl Ether and ethers exhibit antifungal activity against A. niger, A. flavus, A. alternata and F. oxysporum. |
| Synthesis | 2,2'-dinaphthyl ether is a Typical aryl ether compound. The method of synthesizing 2,2'-dinaphthyl ether that has been reported so far is, for example, in the presence of potassium tert-butoxide, adopts DMSO, synthesizes 2,2'-dinaphthyl ether under the condition of not using a catalyst. |
2,2'-Dinaphthyl Ether Preparation Products And Raw materials
| Preparation Products | DINAPHTHO[1,2-B:1',2'-D]FURAN |
