Introduction：Basic information about 2,2-Dimethyl-6-acetyl-2H-1-benzopyran CAS 19013-07-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,2-Dimethyl-6-acetyl-2H-1-benzopyran Basic information
| Product Name: | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran |
| Synonyms: | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran;6-Acetyl-2,2-dimethyl-2H-1-benzopyran;6-Acetyl-2,2-dimethyl-3-chromene;Demethoxyencecalin;Desmethoxyencecalin;Methyl(2,2-dimethyl-2H-1-benzopyran-6-yl) ketone;1-(2,2-Dimethyl-2H-chromen-6-yl)-ethanone;2,2-diMethyl-2H-chroMene |
| CAS: | 19013-07-1 |
| MF: | C13H14O2 |
| MW: | 202.25 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 19013-07-1.mol |
|
2,2-Dimethyl-6-acetyl-2H-1-benzopyran Chemical Properties
| Boiling point | 329.8±42.0 °C(Predicted) |
| density | 1.061±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | Off-white to yellowish solid. |
| color | Yellow to brown |
| InChI | InChI=1S/C13H14O2/c1-9(14)10-4-5-12-11(8-10)6-7-13(2,3)15-12/h4-8H,1-3H3 |
| InChIKey | ZAJTXVHECZCXLH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=C2C(=CC=1)OC(C)(C)C=C2)C |
Safety Information
2,2-Dimethyl-6-acetyl-2H-1-benzopyran Usage And Synthesis
| Uses | Demethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1]. |
| Definition | ChEBI: 6-Acetyl-2,2-dimethyl-2H-1-benzopyran is a 1-benzopyran. |
| Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 32, p. 219, 1995 DOI: 10.1002/jhet.5570320136
Synthesis, p. 144, 1979 DOI: 10.1055/s-1979-28595 |
| References | [1] Prats E, et al. Antifungal activity of a new phenolic compound from capitulum of a head rot-resistant sunflower genotype. J Chem Ecol.?2007 Dec;33(12):2245-53. Epub 2007 Nov 22. DOI:10.1007/s10886-007-9388-9 |
2,2-Dimethyl-6-acetyl-2H-1-benzopyran Preparation Products And Raw materials
