2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol CAS 79538-03-7
Introduction：Basic information about 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol CAS 79538-03-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Basic information
| Product Name: | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol |
| Synonyms: | 2,3,5,6-TETRAFLUORO-4-METHYLBENZYL ALCOHOL;4-METHYL-2,3,5,6-TETRAFLUOROBENZYL ALCOHOL;2,3,5,6-TETRAFLUORO-4-METHYLBENYL ALCOHOL;4-METHYL-2,3,5,6-TETRAFLUOROBENZENEMETHANOL;(4-Methyl-2,3,5,6-tetrafluorophenyl)methanol, 4-(Hydroxymethyl)-2,3,5,6-tetrafluorotoluene;(2,3,5,6-Tetrafluoro-4-Methylphenyl)Methanol;Tefluthrin Related Compound 1;Benzenemethanol, 2,3,5,6-tetrafluoro-4-methyl- |
| CAS: | 79538-03-7 |
| MF: | C8H6F4O |
| MW: | 194.13 |
| EINECS: | 616-698-0 |
| Product Categories: | |
| Mol File: | 79538-03-7.mol |
2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Chemical Properties
| Melting point | 61-62°C |
| Boiling point | 201.4±35.0 °C(Predicted) |
| density | 1.423±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.95±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H6F4O/c1-3-5(9)7(11)4(2-13)8(12)6(3)10/h13H,2H2,1H3 |
| InChIKey | PJCSTULKVNHEGW-UHFFFAOYSA-N |
| SMILES | C1(CO)=C(F)C(F)=C(C)C(F)=C1F |
| CAS DataBase Reference | 79538-03-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| Hazard Note | Irritant |
| HS Code | 2906290020 |
| Chemical Properties | Colorless solid |
2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Preparation Products And Raw materials
| Raw materials | 1,2-Dimethoxyethane-->p-Toluic acid |
