Introduction：Basic information about 2,3-Difluoroanisole CAS 134364-69-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3-Difluoroanisole Basic information
| Product Name: | 2,3-Difluoroanisole |
| Synonyms: | 2,3-DIFLUOROANISOLE;1,2-DIFLUORO-3-METHOXYBENZENE;BENZENE, 1,2-DIFLUORO-3-METHOXY-;Difluoroanisole1;2,3-Difluoroanisole, 97+%;2,3-two fluorineether;1,2-Difluoro-3-methoxybenzene, 2,3-Difluorophenyl methyl ether;3-Difluoroanisole |
| CAS: | 134364-69-5 |
| MF: | C7H6F2O |
| MW: | 144.12 |
| EINECS: | |
| Product Categories: | Fluorine series;blocks;FluoroCompounds;Aromatic Halides (substituted);Phenyls & Phenyl-Het;Fluorobenzene;Phenyls & Phenyl-Het |
| Mol File: | 134364-69-5.mol |
|
2,3-Difluoroanisole Chemical Properties
| Boiling point | 144.5±20.0 °C(Predicted) |
| density | 1.24 |
| refractive index | 1.4710-1.4750 |
| Fp | 62°(144°F) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H6F2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
| InChIKey | RDOGTTNFVLSBKG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(OC)=C1F |
| CAS DataBase Reference | 134364-69-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 10-36/37/38-22 |
| Safety Statements | 16-26-36-37 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | IRRITANT, FLAMMABLE |
| PackingGroup | III |
| HS Code | 29093090 |
2,3-Difluoroanisole Usage And Synthesis
| Chemical Properties | Clear colorless liquid |
| Uses | 2,3-Difluoroaniline was used in the synthesis of ethyl 2-arylamino-4-trifluoromethylpyrimidine-5-carboxylate. |
| Synthesis | 2,3-difluoroanisole can be synthesized by the combined action of 2,3-difluorophenol, DMSO, methyl iodide and potassium carbonate. |
2,3-Difluoroanisole Preparation Products And Raw materials
| Preparation Products | 2,3-Difluorophenol |
