2,4,6-Trimethylbenzenesulfonyl hydrazide CAS 16182-15-3
Introduction:Basic information about 2,4,6-Trimethylbenzenesulfonyl hydrazide CAS 16182-15-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,4,6-Trimethylbenzenesulfonyl hydrazide Basic information
| Product Name: | 2,4,6-Trimethylbenzenesulfonyl hydrazide |
| Synonyms: | 2-MESITYLENESULFONYL HYDRAZIDE;2-MESITYLENESULFONO HYDRAZIDE;MESITYLENESULFONYL HYDRAZIDE;MESITYLENESULFONOHYDRAZIDE;mesitylene-2-sulphonohydrazide;MESITYLENESULFONYL HYDRAZIDE 98+%;2-Mesitylehesulfono hydrazide;[Nle4,D-Phe7]-&alpha |
| CAS: | 16182-15-3 |
| MF: | C9H14N2O2S |
| MW: | 214.28 |
| EINECS: | 240-319-4 |
| Product Categories: | |
| Mol File: | 16182-15-3.mol |
2,4,6-Trimethylbenzenesulfonyl hydrazide Chemical Properties
| Melting point | 112-114 °C (dec.) (lit.) |
| Boiling point | 369.1±52.0 °C(Predicted) |
| density | 1.217 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 9.58±0.10(Predicted) |
| color | White to off-white |
| BRN | 2118380 |
| InChI | InChI=1S/C9H14N2O2S/c1-6-4-7(2)9(8(3)5-6)14(12,13)11-10/h4-5,11H,10H2,1-3H3 |
| InChIKey | JQUBKTQDNVZHIY-UHFFFAOYSA-N |
| SMILES | C1(S(NN)(=O)=O)=C(C)C=C(C)C=C1C |
| CAS DataBase Reference | 16182-15-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 5-11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 4.8 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29350090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | white to off-white crystalline powder |
| Uses | 2,4,6-Trimethylbenzenesulfonohydrazide has been used in the synthesis of:
|
| storage | 2,4,6-Trimethylbenzenesulfonyl hydrazide is stable for many months below 0 °C and should be stored in a freezer. It is a toxic, potentially flammable solid which should be handled with gloves in a fume hood under an inert atmosphere. |
