Introduction：Basic information about CAS 3901-77-7|Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-trivinyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-trivinyl- |
|---|
| CAS Number | 3901-77-7 | Molecular Weight | 258.494 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 201.9±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H18O3Si3 | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 64.2±20.2 °C |
|---|
Names
| Name | Cyclotrisiloxane, 2,4,6-triethenyl-2,4,6-trimethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 201.9±13.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C9H18O3Si3 |
|---|
| Molecular Weight | 258.494 |
|---|
| Flash Point | 64.2±20.2 °C |
|---|
| Exact Mass | 258.056366 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 2.44140 |
|---|
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.448 |
|---|
| InChIKey | BVTLTBONLZSBJC-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si]1(C)O[Si](C)(C=C)O[Si](C)(C=C)O1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | F+ |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | 1993.0 |
|---|
| HS Code | 2901299090 |
|---|
Customs
| HS Code | 2901299090 |
|---|
| Summary | 2901299090 unsaturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Methylvinylsiloxane cyclic trimer |
| 2,4,6-trivinyl-2,4,6-trimethylcyclotrisiloxane |
| 1,3,5-trivinyl-1,3,5-trimethyl-cyclotrisiloxane |
| Cyclotrisiloxane,2,4,6-triethenyl-2,4,6-trimethyl |
| Cyclotrisiloxane,2,4,6-trimethyl-2,4,6-trivinyl |
| 1,3,5-trimethyl-1,3,5-trivinylcyclotrisiloxane |
| Cyclosiloxanes,Me vinyl |
| Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-trivinyl- |
| cyclotris[vinyl(methyl)siloxane] |
| 2,4,6-Trimethyl-2,4,6-trivinylcyclotrisiloxane |
| Cyclotrisiloxane, 2,4,6-triethenyl-2,4,6-trimethyl- |
| 2,4,6-triethenyl-2,4,6-trimethyl-cyclotrisiloxane |
| 2,4,6-Trimethyl-2,4,6-trivinyl-1,3,5,2,4,6-trioxatrisilinane |
