Introduction：Basic information about 2,4-Xylenesulfonic acid CAS 25321-41-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,4-Xylenesulfonic acid Basic information
| Product Name: | 2,4-Xylenesulfonic acid |
| Synonyms: | XSA-65;XSA-90;dimethyl-benzenesulfonicaci;Dimethylbenzenesulfonicacid;dimethyl-Benzenesulfonicacid;xylenesulphonic acid;XSA;2,4-xylenesulfonic acid |
| CAS: | 25321-41-9 |
| MF: | C8H10O3S |
| MW: | 186.23 |
| EINECS: | 246-839-8 |
| Product Categories: | Pharmaceutical Intermediates;K00001 |
| Mol File: | 25321-41-9.mol |
|
2,4-Xylenesulfonic acid Chemical Properties
| Boiling point | 290.72°C (rough estimate) |
| density | 1.3286 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
SURFACTANT - HYDROTROPE |
| InChI | InChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) |
| InChIKey | CHZLVSBMXZSPNN-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(O)C1C=CC(C)=CC=1C |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 25321-41-9(CAS DataBase Reference) |
| EPA Substance Registry System | Xylenesulfonic acid (25321-41-9) |
Safety Information
| RIDADR | 2586 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
2,4-Xylenesulfonic acid Usage And Synthesis
| Uses | 2,4-Xylenesulfonic acid is mainly used as a catalyst for phenolic and furan resin sand core or mold curing systems. |
2,4-Xylenesulfonic acid Preparation Products And Raw materials
| Preparation Products | 2,4-Dimethylbenzenesulfonic acid |
