Introduction：Basic information about 2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol CAS 88-27-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol Basic information
| Product Name: | 2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol |
| Synonyms: | DIMETHYL(3,5-DI-TERT-BUTYL-4-HYDROXYBENZYL)AMINE;IONOX(R) 103;4-DIMETHYLAMINOMETHYL-2,6-DI-TERT-BUTYLPHENOL;2,6-DI-TERT-BUTYL-(A-DIMETHYLAMINO)-P-CRESOL;2,6-DI-TERT-BUTYL-4-(DIMETHYLAMINOMETHYL)PHENOL;TIMTEC-BB SBB007983;2,6-di-tert-butyl-alpha-(dimethylamino)-p-creso;2,6-Di-tert-butyl-alpha-(dimethylamino)-p-cresol |
| CAS: | 88-27-7 |
| MF: | C17H29NO |
| MW: | 263.42 |
| EINECS: | 201-816-1 |
| Product Categories: | Organics;Antioxidant;Polymer Additives;Polymer Science;Stabilizers;88-27-7 |
| Mol File: | 88-27-7.mol |
|
2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol Chemical Properties
| Melting point | 93-94 °C(lit.) |
| Boiling point | 172 °C30 mm Hg(lit.) |
| density | 0.9225 (rough estimate) |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.5020 (estimate) |
| Fp | 138°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 11.17±0.70(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| Water Solubility | 10.7mg/L at 20℃ |
| BRN | 884076 |
| InChI | 1S/C17H29NO/c1-16(2,3)13-9-12(11-18(7)8)10-14(15(13)19)17(4,5)6/h9-10,19H,11H2,1-8H3 |
| InChIKey | VMZVBRIIHDRYGK-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| LogP | 4.24 |
| CAS DataBase Reference | 88-27-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Di-tert-butyl-.alpha.-(dimethylamino)-p-cresol (88-27-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | GO7887000 |
| TSCA | TSCA listed |
| HS Code | 2922.29.8190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 1
Eye Irrit. 2
Skin Sens. 1 |
2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol Usage And Synthesis
| Uses | 2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol, also known as antioxidant 703, is mainly used as an antioxidant in preparing rubber, synthetic resin, gasoline, and oil. |
| Application | 2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol (BHT) is a hindered phenolic compound used as an antioxidant to stabilize lubricating oils. It is also used in organic synthesis. When heated in the presence of BHT, ynamide undergoes a [3 + 2] cycloaddition with an intramolecular 1,2-shift to form a fused pyrrole. |
| Flammability and Explosibility | Non flammable |
| Synthesis | Formaldehyde and 2,6-di-tert-butylphenol can be used as starting materials to prepare 2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol. |
2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol Preparation Products And Raw materials
| Raw materials | Dimethylamine-->Formaldehyde-->Butylated Hydroxytoluene-->2,6-Di-tert-butylphenol |
| Preparation Products | 4,4'-Methylenebis(2,6-di-tert-butylphenol)-->4,4'-Ethylenebis(2,6-ditert-butylphenol)-->2,6-ditert-butyl-4-[di(propan-2-yloxy)phosphorylmethyl]phenol |
