Introduction:Basic information about 25-HydroxyprovitaMin D3 CAS 22145-68-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
25-HydroxyprovitaMin D3 Basic information
| Product Name: | 25-HydroxyprovitaMin D3 |
| Synonyms: | 25-HydroxyprovitaMin D3;IMpurity B of Calcifediol;(3S,9S,10R,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol;Calcifediol EP Impurity B/Cholesta-5,7-diene-3β,25-dio;Calcifediol Impurity 2(Calcifediol EP Impurity B);Calcifediol EP Impurity B;cholesta-5,7-diene-3β,25-diol;Cholesta-5,7-diene-3,25-diol, (3β)- |
| CAS: | 22145-68-2 |
| MF: | C27H44O2 |
| MW: | 400.65 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 22145-68-2.mol |
|
25-HydroxyprovitaMin D3 Chemical Properties
| Melting point | 169-171 °C |
| Boiling point | 527.0±43.0 °C(Predicted) |
| density | 1.05±0.1 g/cm3(Predicted) |
| pka | 14.91±0.70(Predicted) |
| InChIKey | JJFYNCJHSCTBPW-JDBQHWKHNA-N |
| SMILES | C[C@]12CC[C@]3([H])[C@]4(CC[C@H](O)CC4=CC=C3[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C)C |&1:1,4,6,9,16,20,22,r| |
Safety Information
25-HydroxyprovitaMin D3 Usage And Synthesis
| Uses | 25-Hydroxyprovitamin D3 (Chloesterol Impurity 6) is an impurity of Calcifediol (C125700) which is a metabolite of Vitamin D. |
| Definition | ChEBI: Cholesta-5,7-dien-3beta,25-diol is a cholestanoid that is 7-dehydrocholesterol carrying an additional hydroxy substituent at position 25. It has a role as a human metabolite and a Saccharomyces cerevisiae metabolite. It is a 25-hydroxy steroid, a cholestanoid, a 3beta-hydroxy-Delta(5)-steroid and a C27-steroid. It is functionally related to a cholesta-5,7-dien-3beta-ol. |
| General Description | 25-HydroxyprovitaMin D3 (25-OH-7-DHC) is a by-product produced during the synthesis of calcidiol. Calcifediol is a drug used to treat vitamin D deficiency. |
25-HydroxyprovitaMin D3 Preparation Products And Raw materials