2-Amino-3-bromo-5-nitrobenzonitrile CAS 17601-94-4
Introduction：Basic information about 2-Amino-3-bromo-5-nitrobenzonitrile CAS 17601-94-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Amino-3-bromo-5-nitrobenzonitrile Basic informationApplication
| Product Name: | 2-Amino-3-bromo-5-nitrobenzonitrile |
| Synonyms: | 1-amino-2-cyano-4-nitro-6-bromobenzene;2-amino-3-bromo-5-nitro-benzonitril;2-Cyan-4-nitro-6-bromoaniline;2-Cyano-4-nitro-6-bromoaniline;2-AMINO-3-BROMO-5-NITROBENZONITRILE;6-Bromo-2-Cyano-4-Nitroaniline 2-Cyano-4-Nitro-6-Bromoaniline;6-BROMO-2-CYANO-4-NITROANILINE;2-Bromo-6-cyano-4-nitroaniline |
| CAS: | 17601-94-4 |
| MF: | C7H4BrN3O2 |
| MW: | 242.03 |
| EINECS: | 241-574-4 |
| Product Categories: | C6 to C7;Cyanides/Nitriles;blocks;Bromides;Carboxes;Nitrogen Compounds;NitroCompounds;Nitrile |
| Mol File: | 17601-94-4.mol |
2-Amino-3-bromo-5-nitrobenzonitrile Chemical Properties
| Melting point | 180-185 °C(lit.) |
| Boiling point | 374.8±42.0 °C(Predicted) |
| density | 1.8856 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C, protect from light |
| pka | -4.23±0.20(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/C7H4BrN3O2/c8-6-2-5(11(12)13)1-4(3-9)7(6)10/h1-2H,10H2 |
| InChIKey | MUHLVSZIVTURCZ-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(cc1C#N)[N+]([O-])=O |
| CAS DataBase Reference | 17601-94-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzonitrile, 2-amino-3-bromo-5-nitro- (17601-94-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Application | 2-Cyano-4-nitro-6-bromoaniline is an important intermediate for disperse dyes and a crucial raw material for the synthesis of disperse dyes such as Disperse Blue 183. |
| Chemical Properties | yellow powder |
2-Amino-3-bromo-5-nitrobenzonitrile Preparation Products And Raw materials
| Preparation Products | Disperse Blue SE-2R-->Disperse Blue 257-->Disperse Blue 201-->Disperse Blue 211-->Disperse Blue 183-->C.I.Disperse Blue 128 |
