Introduction：Basic information about 2'-Methylacetoacetanilide CAS 93-68-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2'-Methylacetoacetanilide Basic information
| Product Name: | 2'-Methylacetoacetanilide |
| Synonyms: | ACETOACET-O-TOLUIDIDE;ACETO ACET O TOLUIDINE;ACETOACET-2-METHYLANILIDE;AAOT;AKOS B029147;Butanamide, N-(2-methylphenyl)-3-oxo-;ACETOACETO-2-TOLUIDINE;2-Acetoacetotoluidide, 99+% |
| CAS: | 93-68-5 |
| MF: | C11H13NO2 |
| MW: | 191.23 |
| EINECS: | 202-267-0 |
| Product Categories: | Intermediates of Dyes and Pigments;Aromatic amine products |
| Mol File: | 93-68-5.mol |
|
2'-Methylacetoacetanilide Chemical Properties
| Melting point | 104-106 °C(lit.) |
| Boiling point | 326.97°C (rough estimate) |
| density | 1.06 |
| vapor pressure | 0.01 hPa ( 20 °C) |
| refractive index | 1.5220 (estimate) |
| Fp | 143°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.22±0.46(Predicted) |
| form | powder to crystal |
| color | Crystals |
| BRN | 2099098 |
| InChI | 1S/C11H13NO2/c1-8-5-3-4-6-10(8)12-11(14)7-9(2)13/h3-6H,7H2,1-2H3,(H,12,14) |
| InChIKey | TVZIWRMELPWPPR-UHFFFAOYSA-N |
| SMILES | N(c1c(cccc1)C)C(=O)CC(=O)C |
| LogP | 0.9 at 23℃ |
| CAS DataBase Reference | 93-68-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanamide, n-(2-methylphenyl)-3-oxo-(93-68-5) |
| EPA Substance Registry System | Butanamide, N-(2-methylphenyl)-3-oxo- (93-68-5) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-20/21/22 |
| Safety Statements | 36-36/37-24/25 |
| WGK Germany | 1 |
| RTECS | AK6550000 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orl-rat: 1600 mg/kg KODAK* -,N-229,76 |
2'-Methylacetoacetanilide Usage And Synthesis
| Chemical Properties | White to off-white powder |
| Uses | 2'-Methylacetoacetanilide is used as intermediate for the manufacture of organic pigments as well as for the manufacture of agrochemicals. |
| Safety Profile | Moderately toxic by ingestion. When heated to decomposition it emits toxic fumes of NOx,. |
2'-Methylacetoacetanilide Preparation Products And Raw materials
| Raw materials | o-Toluidine-->Acetyl ketene-->o-Anisidine-->Acetoxyacetic acid |
| Preparation Products | Pigment Yellow 14-->4,8-DIMETHYL-2-QUINOLINOL-->2,2-dichloro-N-(2-methylphenyl)acetamide |
