Introduction:Basic information about 3,20-Dioxopregn-4-en-17-beta-yl acetate CAS 17308-02-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,20-Dioxopregn-4-en-17-beta-yl acetate Basic information
| Product Name: | 3,20-Dioxopregn-4-en-17-beta-yl acetate |
| Synonyms: | 17-HYDROXYPROGESTERONE ACETATE;17-ALPHA-HYDROXYPROGESTERONE 17-ACETATE;17ALPHA-HYDROXYPROGESTERONE ACETATE;17ALPHA-HYDROXY-4-PREGNENE-3,20-DIONE 17-ACETATE;17ALPHA-ACETOXYPROGESTERONE;Acetoxypro;17-ACETOXYPROGESTERONE;17ALPHA-ACETOXY-4-PREGNENE-3,20-DIONE |
| CAS: | 17308-02-0 |
| MF: | C23H32O4 |
| MW: | 372.51 |
| EINECS: | 241-337-5 |
| Product Categories: | |
| Mol File: | 17308-02-0.mol |
|
3,20-Dioxopregn-4-en-17-beta-yl acetate Chemical Properties
| Melting point | 198 °C |
| Boiling point | 490.2±45.0 °C(Predicted) |
| density | 1.14±0.1 g/cm3(Predicted) |
| InChI | InChI=1/C23H32O4/c1-14(24)23(27-15(2)25)12-9-20-18-6-5-16-13-17(26)7-10-21(16,3)19(18)8-11-22(20,23)4/h13,18-20H,5-12H2,1-4H3/t18-,19+,20+,21+,22+,23-/s3 |
| InChIKey | VTHUYJIXSMGYOQ-NCZDLRRGNA-N |
| SMILES | O([C@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)C(=O)C)C(=O)C |&1:1,4,6,16,18,22,r| |
| CAS DataBase Reference | 17308-02-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 40-48 |
| Safety Statements | 22-24/25-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TU5074000 |
3,20-Dioxopregn-4-en-17-beta-yl acetate Usage And Synthesis
| Chemical Properties | Crystallized (acetone). Melting point 246.5℃. |
| Uses | 3,20-Dioxopregn-4-en-17-beta-yl acetate, also known as 17-Hydroxyprogesterone acetate, is a new steroidfor oral administration. It has a progestational activitywhich is at least twice that of anhydrohydroxyprogesterone[1]. |
| Mechanism of action | 3,20-Dioxopregn-4-en-17-beta-yl acetate could induces secretory changes in the endometrium and luteal changes in the exfoliated vaginal epithelial cells, reduces fern-like patterns of the cervical mucus, causes a rise of basal body temperature, and induces withdrawal bleeding in castrates[1]. |
| References | [1] Davis M, et al. 17-α-HYDROXYPROGESTERONE ACETATE; AN EFFECTIVE PROGESTATIONAL SUBSTANCE ON ORAL ADMINISTRATION. The Journal of clinical endocrinology and metabolism, 1957; 17: 1237–1244,. |
3,20-Dioxopregn-4-en-17-beta-yl acetate Preparation Products And Raw materials
| Raw materials | 16a,17a-Epoxyprogesterone-->17α-Hydroxyprogesterone |