Introduction：Basic information about 3,5-Difluoronitrobenzene CAS 2265-94-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Difluoronitrobenzene Basic information
| Product Name: | 3,5-Difluoronitrobenzene |
| Synonyms: | 3,5-Difluoronitrobenzene 99%;1,3-DIFLUORO-5-NITROBENZENE;3,5-DIFLUORONITROBENZENE;Benzene, 1,3-difluoro-5-nitro- (7CI,8CI,9CI);1-Nitro-3,5-difluorobenzene;3,5-Difluoro-1-nitrobenzene;5-Nitro-1,3-phenylene difluoride;3,5-Difluoronitrobenzene ,98% |
| CAS: | 2265-94-3 |
| MF: | C6H3F2NO2 |
| MW: | 159.09 |
| EINECS: | 218-867-0 |
| Product Categories: | Aromatic Halides (substituted);Miscellaneous;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;HALIDE;Halides |
| Mol File: | 2265-94-3.mol |
|
3,5-Difluoronitrobenzene Chemical Properties
| Melting point | 17 °C (lit.) |
| Boiling point | 176-177 °C (lit.) |
| density | 1.407 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.499(lit.) |
| RTECS | CZ5712000 |
| Fp | 165 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Specific Gravity | 1.407 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3F2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H |
| InChIKey | AUQBBDWDLJSKMI-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(F)cc(F)c1 |
| CAS DataBase Reference | 2265-94-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3265 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
3,5-Difluoronitrobenzene Usage And Synthesis
| Chemical Properties | Clear yellow liquid |
| Uses | 3,5-Difluoronitrobenzene has been used to improve thermal stability of immobilized porcine pancrease lipase. |
| General Description | Molecular structure of 3,5-difluoronitrobenzene was studied by gas-phase electron diffraction, MP2 ab initio and by B3LYP density functional calculations. |
3,5-Difluoronitrobenzene Preparation Products And Raw materials
| Preparation Products | 2,4-dibromo-1,3,5-trifluorobenzene-->2,4,6-Trifluorochlorobenzene-->3,5-Difluorochlorobenzene-->1-Fluoro-3-nitrobenzene |
