3,5-Difluorophenol CAS 2713-34-0
Introduction：Basic information about 3,5-Difluorophenol CAS 2713-34-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Difluorophenol Basic information
| Product Name: | 3,5-Difluorophenol |
| Synonyms: | 3,5-DIFLUOROPHENOL;Phenol,3,5-difluoro-;3,5-Difluorophenol,98+%;3,5-Difluorophenol 99%;3,5-Difluorophenol99%;3,5-Diflourophenol;3,5-Difluorophenol, 99% 1GR;3, 5 - two fluorine phenol |
| CAS: | 2713-34-0 |
| MF: | C6H4F2O |
| MW: | 130.09 |
| EINECS: | 608-047-4 |
| Product Categories: | Aromatic Phenols;Fluorobenzene;Phenol&Thiophenol&Mercaptan;Fluorophenols;Fluorobenzene Series;Organic Building Blocks;Oxygen Compounds;Phenols;Heterocyclic Acids;intermediate |
| Mol File: | 2713-34-0.mol |
3,5-Difluorophenol Chemical Properties
| Melting point | 54-57 °C (lit.) |
| Boiling point | 65-68°C 1mm |
| density | 1.2483 (estimate) |
| Fp | 159 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: soluble50, clear, colorless to faint yellow or tan (mg/mL) |
| pka | 7.97±0.10(Predicted) |
| form | Crystals |
| color | White to beige |
| BRN | 2078616 |
| InChI | InChI=1S/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | HJSSBIMVTMYKPD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 2713-34-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Difluorophenol(2713-34-0) |
Safety Information
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 20/21/22-36/37/38-34-11 |
| Safety Statements | 26-36-45-36/37/39-16 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29081000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | white to beige crystals |
| Uses | 3,5-Difluorophenol is an important medicine, pesticide, and liquid crystal material intermediate, mainly used in the synthesis of liquid crystal materials and antifungal agents, and also used in the synthesis of dyes, plastics and rubber additives. |
| Synthesis | 461-96-1 2713-34-0 The general procedure for the synthesis of 3,5-difluorophenol from 3,5-difluorobromobenzene was as follows: referring to the method described in Example 1, the feedstock was replaced with 96.5 g (0.5 mol) of 3,5-difluoro-1-bromobenzene, and Raney Ni was used as a catalyst. The reaction temperature was raised to 130 °C and pressurized to 0.8 MPa under nitrogen atmosphere. keeping the rest of the reaction conditions unchanged, 52.6 g of 3,5-difluorophenol was finally obtained, with a melting point of 39-41 °C, a yield of 80.8%, and a product purity of 99.65%. |
| References | [1] Patent: CN105384603, 2016, A. Location in patent: Paragraph 0030 |
3,5-Difluorophenol Preparation Products And Raw materials
| Raw materials | 1,3,5-Trifluorobenzene-->1-Bromo-3,5-difluorobenzene-->Potassium hydroxide-->Sulfolane |
| Preparation Products | 2,6-Difluoro-4-hydroxybenzonitrile-->2,6-DIFLUORO-4-HYDROXYBENZALDEHYDE-->3,5-Difluorobenzoic acid-->tert-butyl(3,5-difluorophenoxy)dimethylsilane-->2-(3,5-Difluorophenoxy)acetic acid-->4-tert-butyl-3,5-difluorophenol-->4-Butoxy-2,6-difluorobenzoicacid |
