Introduction：Basic information about 3,5-Dimethylbenzoyl chloride CAS 6613-44-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Dimethylbenzoyl chloride Basic information
| Product Name: | 3,5-Dimethylbenzoyl chloride |
| Synonyms: | 3,5-dimethyl-benzoylchlorid;3,5-DIMETHYLBENZOYL CHLORIDE;3,5-DimethylbenzoicChloride;Benzoyl chloride, 3,5-dimethyl- (6CI,7CI,8CI,9CI);3,5-Dimethylbenzoyl;m-xylene-5-carbonyl chloride;Benzoylchloride,3,5-dimethyl-;3,5-Dimethylbenzoic acid chloride |
| CAS: | 6613-44-1 |
| MF: | C9H9ClO |
| MW: | 168.62 |
| EINECS: | 413-010-9 |
| Product Categories: | ACIDHALIDE |
| Mol File: | 6613-44-1.mol |
|
3,5-Dimethylbenzoyl chloride Chemical Properties
| Boiling point | 127 °C / 20mmHg |
| density | 1.14 |
| vapor pressure | 5.2Pa at 25℃ |
| refractive index | 1.5440-1.5480 |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C9H9ClO/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3 |
| InChIKey | ZJIOBDJEKDUUCI-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC(C)=CC(C)=C1 |
| LogP | 2.85 |
| CAS DataBase Reference | 6613-44-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoyl chloride, 3,5-dimethyl- (6613-44-1) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| RTECS | DM6636900 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2916399050 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
Skin Sens. 1 |
3,5-Dimethylbenzoyl chloride Usage And Synthesis
| Uses | 3,5-Dimethylbenzoyl Chloride-d9 is an intermediate in the synthesis of Methoxyfenozide-d9 (M262768), deuterium labelled Methoxyfenozide (M262765). It is used primarily as an insecticide, and pesticide. |
3,5-Dimethylbenzoyl chloride Preparation Products And Raw materials
| Raw materials | 3-Hydroxybenzoic acid-->3,5-Dimethylbenzoic acid |
| Preparation Products | Tebufenozide-->METHYL 3,5-DIMETHYLBENZOATE-->N-methoxy-N,3,5-trimethylbenzamide |
