Introduction:Basic information about 3-Thiocyanatopropyltriethoxysilane CAS 34708-08-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Thiocyanatopropyltriethoxysilane Basic informationDescription
| Product Name: | 3-Thiocyanatopropyltriethoxysilane |
| Synonyms: | triethoxy(3-thiocyanatopropyl)silane;thiocyanicacid,3-(triethoxysilyl)propylester;3-THIOCYANATOPROPYLTRIETHOXYSILANE;3-THIOCYANOTOPROPYLTRIETHOXYSILANE;3-Thiocyanatopropyltriethoxysilan;-THIOCYANATOPROPYLTRIETHOXYSILANE;Si-264;Triethoxy(3-thiocyanatopropyl) |
| CAS: | 34708-08-2 |
| MF: | C10H21NO3SSi |
| MW: | 263.43 |
| EINECS: | 252-161-3 |
| Product Categories: | Adhesion Promoters;Coupling Agents;Surface Modifiers;Thiocyanato Silanes |
| Mol File: | 34708-08-2.mol |
|
3-Thiocyanatopropyltriethoxysilane Chemical Properties
| Melting point | <0°C |
| Boiling point | 95 °C |
| density | 1.03 |
| vapor pressure | 0-7910Pa at 25℃ |
| refractive index | 1.446 |
| Fp | 112°C |
| form | liquid |
| color | Clear, pale yellow |
| Specific Gravity | 1.03 |
| Water Solubility | 140-1000000mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C10H21NO3SSi/c1-4-12-16(13-5-2,14-6-3)9-7-8-15-10-11/h4-9H2,1-3H3 |
| InChIKey | HKMVWLQFAYGKSI-UHFFFAOYSA-N |
| SMILES | S(CCC[Si](OCC)(OCC)OCC)C#N |
| LogP | -1.5-3.1 at 20℃ |
| CAS DataBase Reference | 34708-08-2(CAS DataBase Reference) |
| EPA Substance Registry System | Thiocyanic acid, 3-(triethoxysilyl)propyl ester (34708-08-2) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-52/53-22 |
| Safety Statements | 26-36/37/39-61 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
3-Thiocyanatopropyltriethoxysilane Usage And Synthesis
| Description | 3-Thiocyanatopropyltriethoxysilane is a bifunctional, sulfur-containing organosilane for rubber applications in combination with white fillers containing silanol groups.
In silane industry, it has good features that includes:- It can improve reinforcing properties of fillers that contain hydroxyl groups.
- It can improve physical and mechanical properties of vulcanizates. It can improve tensile strength, tearing strength and abrasive resistance and reduce compression set of vulcanizates. In addition, it can reduce the viscosity and improve the processability of rubber products.
|
| Chemical Properties | Straw to yellowish liquid with mild odor |
| Flammability and Explosibility | Not classified |
3-Thiocyanatopropyltriethoxysilane Preparation Products And Raw materials
| Raw materials | 3-isothiocyanatopropyltriethoxysilane |