Introduction：Basic information about 3-Thiophenecarbonyl chloride CAS 41507-35-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Thiophenecarbonyl chloride Basic information
| Product Name: | 3-Thiophenecarbonyl chloride |
| Synonyms: | 3-THIOPHENECARBONYL CHLORIDE;AKOS 92497;3-Thiophenecarbonyl chloride (6CI, 9CI);3-Thienylcarbonylchloride;Thiophene-3-carbonyl chloride;3-thenoyl chloride;3-Thiopheneformyl chloride;3-Thiophenecarboxylic acid chloride |
| CAS: | 41507-35-1 |
| MF: | C5H3ClOS |
| MW: | 146.59 |
| EINECS: | 255-420-9 |
| Product Categories: | Carbonyl Chlorides;Thiophenes & Benzothiophenes;ACIDHALIDE;Thiophene&Benzothiophene;Carbonyl Chlorides;Thiophenes & Benzothiophenes |
| Mol File: | 41507-35-1.mol |
|
3-Thiophenecarbonyl chloride Chemical Properties
| Melting point | 50 °C |
| Boiling point | 195.4±13.0 °C(Predicted) |
| density | 1.391±0.06 g/cm3(Predicted) |
| Fp | 51°(124°F) |
| storage temp. | 2-8°C |
| form | solid |
| color | White |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C5H3ClOS/c6-5(7)4-1-2-8-3-4/h1-3H |
| InChIKey | QTWBEVAYYDZLQL-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1C=CSC=1)=O |
| CAS DataBase Reference | 41507-35-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,F |
| Risk Statements | 34-29-14-11 |
| Safety Statements | 26-36/37/39-8-45-30-22 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 2934999090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 2
Skin Corr. 1B |
3-Thiophenecarbonyl chloride Usage And Synthesis
| Chemical Properties | white to light yellow crystal powder |
3-Thiophenecarbonyl chloride Preparation Products And Raw materials
| Raw materials | Thionyl chloride-->Toluene-->3-Thiophenezoic acid-->1-Iodo-4-nitrobenzene-->METHYL 3-THIOPHENECARBOXYLATE 97-->3-IODOTHIOPHENE-->4-Iodobenzoyl chloride-->carbon monoxide-->4-Nitrobenzoyl chloride-->3-Bromothiophene-->1,1-Dichlorodimethyl ether-->Terephthaloyl chloride |
| Preparation Products | 3-Thienyl isocyanate |
