Introduction：Basic information about 4,4'-Oxydiphenol CAS 1965-09-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-Oxydiphenol Basic information
| Product Name: | 4,4'-Oxydiphenol |
| Synonyms: | Bis(4-hydroxyphenyl) Ether4,4'-Oxydiphenol;4,4'-Dihydroxydiphenyl Ether, 98.0%(GC);4',4-OXIDIPHENOL;p,p’-oxydiphenol;p,p'-Oxydiphenol;Phenol, 4,4'-oxydi-;p-Hydroxyphenyl ether;BIS(4-HYDROXYPHENYL) ETHER |
| CAS: | 1965-09-9 |
| MF: | C12H10O3 |
| MW: | 202.21 |
| EINECS: | 217-809-1 |
| Product Categories: | Biphenyl & Diphenyl ether;Color Former & Related Compounds;Developer;Diphenyl Ethers (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Aromatic Ethers |
| Mol File: | 1965-09-9.mol |
|
4,4'-Oxydiphenol Chemical Properties
| Melting point | 163-168 °C |
| Boiling point | 300.32°C (rough estimate) |
| density | 1.1868 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| pka | 9.90±0.15(Predicted) |
| form | Amorphous Powder |
| color | Off-white |
| InChI | InChI=1S/C12H10O3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | NZGQHKSLKRFZFL-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| CAS DataBase Reference | 1965-09-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4,4'-oxybis-(1965-09-9) |
| EPA Substance Registry System | Phenol, 4,4'-oxybis- (1965-09-9) |
Safety Information
| Safety Statements | 24/25 |
| RTECS | SM6040000 |
| TSCA | TSCA listed |
| HS Code | 29095000 |
| Toxicity | LD50 ipr-mus: 150 mg/kg NTIS** AD691-490 |
4,4'-Oxydiphenol Usage And Synthesis
| Chemical Properties | off-white amorphous powder |
| Uses | 4,4'-Oxydiphenol can be used as a pharmaceutical intermediates. |
| Safety Profile | Poison by intraperitoneal route. When heated to decomposition it emits acrid smoke and irritating fumes. |
4,4'-Oxydiphenol Preparation Products And Raw materials
| Raw materials | Bis(4-bromophenyl) ether-->Cyclohexanone, 3,4,5-trihydroxy-, (3R,5R)--->4,4'-Diacetoxydiphenyl ether-->4-IODOPHENYL ETHER-->BIS-(4-METHOXYPHENYL) ETHER-->6-Oxabicyclo[3.2.1]octan-7-one, 1,3,4-trihydroxy-, (1S,3R,4R,5R)--->4-CHLOROPHENYL ETHER-->Quinic acid-->4-ACETYLPHENYL ETHER-->4,4'-Oxydianiline-->4-Fluorobenzaldehyde-->Diphenyl ether-->Hydroquinone |
| Preparation Products | REACTIONPRODUCTOF44OXYDIPHENOLWITH1CHLORO23EPOXYPROPANE |
