4,5-DIMETHYL-2-NITROANILINE CAS 6972-71-0
Introduction:Basic information about 4,5-DIMETHYL-2-NITROANILINE CAS 6972-71-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,5-DIMETHYL-2-NITROANILINE Basic information
| Product Name: | 4,5-DIMETHYL-2-NITROANILINE |
| Synonyms: | TIMTEC-BB SBB003892;2-NITRO-4,5-DIMETHYL ANILINE;4,5-dimethyl-2-nitro-benzenamin;6-NITRO-3,4-XYLIDINE;4,5-DIMETHYL-2-NITROANILINE;2-nitro-4,5-xylidine;4,5-DIMETHYL-2-NITROANILINE / 6-NITRO-3,4-XYLIDINE;2-Amino-4,5-dimethylnitrobenzene, 6-Nitro-3,4-xylidine, 4-Amino-5-nitro-o-xylene |
| CAS: | 6972-71-0 |
| MF: | C8H10N2O2 |
| MW: | 166.18 |
| EINECS: | 230-211-5 |
| Product Categories: | Amines;C8;Nitrogen Compounds |
| Mol File: | 6972-71-0.mol |
4,5-DIMETHYL-2-NITROANILINE Chemical Properties
| Melting point | 139-141 °C(lit.) |
| Boiling point | 314.38°C (rough estimate) |
| density | 1.2275 (estimate) |
| refractive index | 1.6273 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 0.71±0.25(Predicted) |
| form | powder |
| Appearance | Light brown to reddish brown Solid |
| BRN | 2209637 |
| InChI | 1S/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
| InChIKey | PINGKGKKUSYUAW-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c(cc1C)[N+]([O-])=O |
| CAS DataBase Reference | 6972-71-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4,5-Dimethyl-2-nitroaniline (6972-71-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | brown crystalline powder |
| Uses | Used to synthesize metal complexes. |
4,5-DIMETHYL-2-NITROANILINE Preparation Products And Raw materials
| Raw materials | Sulfuric acid-->Nitric acid-->Benzene-->3,4-Dimethylaniline |
| Preparation Products | 2-Iodo-4,5-dimethylnitrobenzene-->1-bromo-4,5-dimethyl-2-nitrobenzene-->3-Nitro-4-(1H-pyrrol-1-yl)benzenol-->N-(2-amino-4,5-dimethylphenyl)acetamide(SALTDATA: FREE)-->N-(4,5-DIMETHYL-2-NITRO-PHENYL)-ACETAMIDE |
