4-Amino-3,5-dichlorobenzotrifluoride CAS 24279-39-8
Introduction:Basic information about 4-Amino-3,5-dichlorobenzotrifluoride CAS 24279-39-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Amino-3,5-dichlorobenzotrifluoride Basic informationUses preparation
| Product Name: | 4-Amino-3,5-dichlorobenzotrifluoride |
| Synonyms: | 3,5-DICHLORO-4-AMINO BENZOTRIFLUORIDE;2,6-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE;BUTTPARK 29\06-100;TIMTEC-BB SBB003283;2,6-dichloro-4-Trifluoromethyllaniline;4-Amino-3,5-dichlorobenzotrifluoride,97% (2,6-Dichloro-4-trifluoromethylaniline);2,6-dichloro-(trifluoromethyl)aniline;2,6-Dichloro-4-(trifluoromethyl)aniline 99% |
| CAS: | 24279-39-8 |
| MF: | C7H4Cl2F3N |
| MW: | 230.01 |
| EINECS: | 416-430-0 |
| Product Categories: | Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;amine| alkyl chloride;Pesticide Intermediate;Nitrogen Compounds;Benzenes;Amines;C7;API intermediates;Aniline;Fluorochemicals;Anilines, Aromatic Amines and Nitro Compounds;Aromatic Halides (substituted);Trifluoromethylbenzene serise;bc0001 |
| Mol File: | 24279-39-8.mol |
4-Amino-3,5-dichlorobenzotrifluoride Chemical Properties
| Melting point | 34-36 °C(lit.) |
| Boiling point | 60-62 °C1 mm Hg(lit.) |
| density | 1.532 g/mL at 25 °C(lit.) |
| Fp | 190 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -1.13±0.10(Predicted) |
| Specific Gravity | 1.532 |
| color | White to Orange to Green |
| BRN | 2838819 |
| InChI | InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 24279-39-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N,T |
| Risk Statements | 20/22-38-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Uses | 2,6-Dichloro-4-(trifluoromethyl)aniline is used in the synthesis of GABA receptor antagonists and insecticides. |
| preparation | Using 4-chlorotrifluoromethylbenzene as raw material, 2,6-dichloro-4-trifluoromethylaniline was prepared through two-step reaction of amination and chlorination. |
| Chemical Properties | light yellow low melting crystalline mass or |
| Uses | 2,6-Dichloro-4-(trifluoromethyl)aniline may be employed for the synthesis of 1-[2,6-di-chloro-4-(tri-fluoro-methyl)-phenyl]-5-[(4-nitro-phenyl)-methyl-ene-imino]-1H-pyrazole-3-carbo-nitrile. |
4-Amino-3,5-dichlorobenzotrifluoride Preparation Products And Raw materials
| Raw materials | 4-Aminobenzotrifluoride-->4-Chlorobenzotrifluoride |
| Preparation Products | 5-[2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL]-2-FURALDEHYDE-->1-[2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL]-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE-->5-Amino-3-cyano-1-(2,6-dichloro-4-trifluoromethylphenyl)pyrazole |
