Introduction：Basic information about 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 CAS 51624-40-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Basic information
- 2. 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Chemical Properties
- 3. Safety Information
- 4. 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Usage And Synthesis
- 5. 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Preparation Products And Raw materials
4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Basic information
| Product Name: | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 |
| Synonyms: | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5;4-Bromo-1,1'-biphenyl-d5;4-Bromo-1,1'-biphenyl-d5 |
| CAS: | 51624-40-9 |
| MF: | C12H4BrD5 |
| MW: | 238.13466889 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 51624-40-9.mol |
|
4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Chemical Properties
| Melting point | 89 °C(Solv: methanol (67-56-1)) |
| InChI | InChI=1S/C12H9Br/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H/i1D,2D,3D,4D,5D |
| InChIKey | PKJBWOWQJHHAHG-RALIUCGRSA-N |
| SMILES | C1(C2=CC=C(Br)C=C2)=C([2H])C([2H])=C([2H])C([2H])=C1[2H] |
Safety Information
4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Usage And Synthesis
| Description | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 is a deuterated biphenyl derivative, which offers distinct advantages in analytical and biochemical research due to its isotopic signature. |
4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Preparation Products And Raw materials
