Introduction：Basic information about 4-Chlorobiphenyl CAS 2051-62-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Chlorobiphenyl Basic information
| Product Name: | 4-Chlorobiphenyl |
| Synonyms: | 4-Chlorobiphenyl, 4-PCB;4-Chlorobiphenyl 50mg [2051-62-9];1,1'-Biphenyl-4-yl Chloride;4-Biphenylyl Chloride;NSC 37066;1,1'-Biphenyl,4-chloro-;1’-Biphenyl,4-chloro-1;1-Chloro-4-phenylbenzene |
| CAS: | 2051-62-9 |
| MF: | C12H9Cl |
| MW: | 188.65 |
| EINECS: | 218-127-7 |
| Product Categories: | Aromatics |
| Mol File: | 2051-62-9.mol |
|
4-Chlorobiphenyl Chemical Properties
| Melting point | 32 °C(lit.) |
| Boiling point | 130°C/1mm |
| density | 1.1320 (estimate) |
| refractive index | 1.5830 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| Major Application | environmental |
| InChI | InChI=1S/C12H9Cl/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | FPWNLURCHDRMHC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 2051-62-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Biphenyl, 4-chloro-(2051-62-9) |
| EPA Substance Registry System | 4-Chlorobiphenyl (2051-62-9) |
Safety Information
| Hazard Codes | N,Xi |
| Risk Statements | 33-50/53-36/37/38 |
| Safety Statements | 35-60-61-36-26 |
| RIDADR | UN 3432 9/PG 2 |
| WGK Germany | 3 |
| RTECS | DV2080000 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
STOT RE 2 |
| Toxicity | mammal (species unspecified),LDLo,oral,3500mg/kg (3500mg/kg),Journal of Industrial Hygiene. Vol. 13, Pg. 87, 1931. |
4-Chlorobiphenyl Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | 4-Chloro-1,1’-biphenyl (cas# 2051-62-9) is a compound useful in organic synthesis. |
| Definition | ChEBI: A monochlorobiphenyl carrying a chloro substituent at position 4. |
| Synthesis Reference(s) | Synthetic Communications, 11, p. 513, 1981 DOI: 10.1080/00397918108063618
Tetrahedron Letters, 30, p. 963, 1989 |
| General Description | Colorless crystals or shiny off-white flakes. |
| Air & Water Reactions | Insoluble in water. |
| Reactivity Profile | Simple aromatic halogenated organic compounds, such as 4-Chlorobiphenyl, are very unreactive. Reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. Materials in this group may be incompatible with strong oxidizing and reducing agents. Also, they may be incompatible with many amines, nitrides, azo/diazo compounds, alkali metals, and epoxides. |
| Fire Hazard | Flash point data for 4-Chlorobiphenyl are not available. 4-Chlorobiphenyl is probably combustible. |
4-Chlorobiphenyl Preparation Products And Raw materials
| Raw materials | Benzenediazonium, p-chloro-, tetrafluoroborate(1-)-->Phenyltriethoxysilane-->4-Chlorophenylhydrazine-->1,4-Dichlorobenzene |
| Preparation Products | 4-Isopropylbiphenyl-->4-Biphenylacetonitrile-->N-4-Biphenylylbenzenesulfonamide-->Phosphine sulfide, tris([1,1'-biphenyl]-4-yl)- |
