Introduction:Basic information about CAS 3152-15-6|3-(4-CHLOROPHENYL)-2,5-FURANDIONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-CHLOROPHENYL)-2,5-FURANDIONE |
|---|
| CAS Number | 3152-15-6 | Molecular Weight | 208.59800 |
|---|
| Density | 1.488g/cm3 | Boiling Point | 367.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H5ClO3 | Melting Point | 152-154ºC |
|---|
| MSDS | / | Flash Point | 169.9ºC |
|---|
Names
| Name | 3-(4-chlorophenyl)furan-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.488g/cm3 |
|---|
| Boiling Point | 367.3ºC at 760mmHg |
|---|
| Melting Point | 152-154ºC |
|---|
| Molecular Formula | C10H5ClO3 |
|---|
| Molecular Weight | 208.59800 |
|---|
| Flash Point | 169.9ºC |
|---|
| Exact Mass | 207.99300 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.80680 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | BSZGHMTWYIUDFZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=C(c2ccc(Cl)cc2)C(=O)O1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3-(4-chlorophenyl)maleic anhydride |
| 3-(4-Chlorophenyl)-2,5-furandione |
| 3-(4-chlorophenyl)-2,5-dihydrofuran-2,5-dione |
| 1-(4-Chlorphenyl)maleinsaeureanhydrid |
| chlorophenylfurandione |
| p-[Chlorophenyl]maleic anhydride |
| (4-Chlor-phenyl)-maleinsaeure-anhydrid |
| 2-(4-chlorophenyl)maleic anhydride |
| (4-chloro-phenyl)-maleic acid anhydride |