Introduction：Basic information about 4-Nitronaphthalene-1,8-dicarboxylic anhydride CAS 34087-02-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Nitronaphthalene-1,8-dicarboxylic anhydride Basic information
| Product Name: | 4-Nitronaphthalene-1,8-dicarboxylic anhydride |
| Synonyms: | 4-NITRONAPHTHALENE-1,8-DICARBOXYLIC ANHYDRIDE;4-NITRO-1,8-NAPHTHALIC ANHYDRIDE;4-NITRO-1,8-NAPHTHALIC ANHYDRIDE 95+%;1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 4-nitro-;6-nitrobenzo[de]isochroMene-1,3-dione;4-Nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione;4-Nitrophthalene-1,8-dicarboxylic anhydride;4-Nitrobenzo[de]isochromene-1,3-dione |
| CAS: | 34087-02-0 |
| MF: | C12H5NO5 |
| MW: | 243.17 |
| EINECS: | |
| Product Categories: | Intermediates of Dyes and Pigments;Phthalic Acids, Esters and Derivatives |
| Mol File: | 34087-02-0.mol |
|
4-Nitronaphthalene-1,8-dicarboxylic anhydride Chemical Properties
| Melting point | 226-229 °C(lit.) |
| Boiling point | 512.9±33.0 °C(Predicted) |
| density | 1.637±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| Appearance | Yellow to orange Solid |
| InChI | InChI=1S/C12H5NO5/c14-11-7-3-1-2-6-4-5-8(13(16)17)10(9(6)7)12(15)18-11/h1-5H |
| InChIKey | QLYSDTXUBZEOII-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=C([N+]([O-])=O)C=CC3=C2C1=CC=C3 |
| CAS DataBase Reference | 34087-02-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 9-21 |
| Hazard Note | Irritant |
4-Nitronaphthalene-1,8-dicarboxylic anhydride Usage And Synthesis
| Chemical Properties | light yellow powder |
4-Nitronaphthalene-1,8-dicarboxylic anhydride Preparation Products And Raw materials
| Raw materials | 5-NITROACENAPHTHENE |
| Preparation Products | Solvent Yellow 98 |
