Introduction：Basic information about 5-HYDROXY-7-METHOXYFLAVONE CAS 520-28-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-HYDROXY-7-METHOXYFLAVONE Basic information
| Product Name: | 5-HYDROXY-7-METHOXYFLAVONE |
| Synonyms: | 2-Phenyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one;7-Methoxy-2-phenyl-5-hydroxy-4H-1-benzopyran-4-one;Techto;NSC 80687;Techtochrysine;TECTOCHRYSIN;CHRYSIN 7-METHYL ETHER;METHYL CHRYSIN |
| CAS: | 520-28-5 |
| MF: | C16H12O4 |
| MW: | 268.26 |
| EINECS: | |
| Product Categories: | Di-substituted Flavones |
| Mol File: | 520-28-5.mol |
|
5-HYDROXY-7-METHOXYFLAVONE Chemical Properties
| Melting point | 166-168°C |
| Boiling point | 487.4±45.0 °C(Predicted) |
| density | 1.329±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO : 16.67 mg/mL (62.14 mM; Need ultrasonic) |
| form | powder |
| pka | 6.34±0.40(Predicted) |
| color | White |
| InChI | InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| InChIKey | IRZVHDLBAYNPCT-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=CC(OC)=CC(O)=C2C(=O)C=1 |
| LogP | 3.130 (est) |
| CAS DataBase Reference | 520-28-5(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
5-HYDROXY-7-METHOXYFLAVONE Usage And Synthesis
| Chemical Properties | White needle-shaped crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the heartwood of Pinus cembra L. |
| Uses | Tectochrysin (Standard) is the analytical standard of Tectochrysin. This product is intended for research and analytical applications. Tectochrysin (Techtochrysin) is one of the major flavonoids of Alpinia oxyphylla Miquel. Tectochrysin inhibits activity of NF-κB. |
| Definition | ChEBI: A monohydroxyflavone that is flavone substituted by a hydroxy group at position 4 and a methoxy group at position 7 respectively. |
| target | STAT | Caspase | Bcl-2/Bax | ATPase |
5-HYDROXY-7-METHOXYFLAVONE Preparation Products And Raw materials
| Raw materials | 5,7-DIMETHOXYFLAVONE-->Chrysin-->Dimethyl carbonate |
