Introduction：Basic information about 5-hydroxy-7,8-dimethoxyflavone CAS 3570-62-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-hydroxy-7,8-dimethoxyflavone Basic information
| Product Name: | 5-hydroxy-7,8-dimethoxyflavone |
| Synonyms: | 5-hydroxy-7,8-dimethoxyflavone;MOSLOSOOFLAVONE;HYDROXYDIMETHOXYFLAVONE;7,8-Dimethoxy-5-hydroxyflavone;7,8-Dimethoxynorwogonin;7-O-Methylwogonin;7-O-Methylwogonine;MOSLOSOOFLAVONE;5-HYDROXY-7,8-DIMETHOXYFLAVONE; 7-O-METHYLWOGONIN |
| CAS: | 3570-62-5 |
| MF: | C17H14O5 |
| MW: | 298.29 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 3570-62-5.mol |
|
5-hydroxy-7,8-dimethoxyflavone Chemical Properties
| Melting point | 182-183℃ |
| Boiling point | 532.9±50.0 °C(Predicted) |
| density | 1.321 |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 6.83±0.40(Predicted) |
| color | Light yellow to yellow |
| BRN | 292995 |
| InChI | InChI=1S/C17H14O5/c1-20-14-9-12(19)15-11(18)8-13(10-6-4-3-5-7-10)22-17(15)16(14)21-2/h3-9,19H,1-2H3 |
| InChIKey | IHLSBQVBFDTNTC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=C(OC)C(OC)=CC(O)=C2C(=O)C=1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
5-hydroxy-7,8-dimethoxyflavone Usage And Synthesis
| Chemical Properties | Yellow crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Capsella ramie. |
| Uses | Moslosooflavone (Standard) is the analytical standard of Moslosooflavone. This product is intended for research and analytical applications. Moslosooflavone is a flavonoid isolated from Andrographis paniculata. Moslosooflavone has an anti-hypoxia and anti-inflammatory activities. |
5-hydroxy-7,8-dimethoxyflavone Preparation Products And Raw materials
