Introduction:Basic information about 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE CAS 19932-84-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Basic information
| Product Name: | 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE |
| Synonyms: | 6-CHLORO-2-BENZOXAZOLINONE;6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE;6-CHLOROBENZOXAZOLONE;6-CHLOROBENZOXAZOL-2(3H)-ONE;6-CHLOROOXAZONE;6-chloro-3a,7a-dihydro-3H-1,3-benzoxazol-2-one;TIMTEC-BB SBB003865;2-Benzoxazolinone, 6-chloro- |
| CAS: | 19932-84-4 |
| MF: | C7H4ClNO2 |
| MW: | 169.57 |
| EINECS: | |
| Product Categories: | AmidesAnalytical Standards;EstersMore...Close...;Alpha Sort;Analytical Standards;AromaticsVolatiles/ Semivolatiles;C;CAlphabetic;CHChemical Class;Chemical Class;ChloroAnalytical Standards;Halogenated;Oxazole&Isoxazole |
| Mol File: | 19932-84-4.mol |
|
6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Chemical Properties
| Melting point | 192 °C |
| density | 1.3771 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 8.34±0.70(Predicted) |
| form | Crystalline Powder |
| color | Light beige |
| InChI | InChI=1S/C7H4ClNO2/c8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,9,10) |
| InChIKey | MATCZHXABVLZIE-UHFFFAOYSA-N |
| SMILES | O1C2=CC(Cl)=CC=C2NC1=O |
| CAS DataBase Reference | 19932-84-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2(3H)-Benzoxazolone, 6-chloro- (19932-84-4) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-26/36/37/39-22-36/37/39 |
| WGK Germany | 3 |
| RTECS | DM5252000 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Usage And Synthesis
| Chemical Properties | light beige crystalline powder |
| Uses | 6-Chloro-1,3-Benzoxazol-2(3H)-One is used in preparation of substituted triazoles as potent ABA receptor pan-antagonists. |
6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Preparation Products And Raw materials
| Preparation Products | 2,6-Dichlorobenzoxazole-->6-Chloro-2-benzoxazolethiol-->6-chloro-3-(hydroxymethyl)benzoxazol-2(3H)-one |