Introduction：Basic information about 6-Chloro-1-hydroxibenzotriazol CAS 26198-19-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-Chloro-1-hydroxibenzotriazol Basic information
| Product Name: | 6-Chloro-1-hydroxibenzotriazol |
| Synonyms: | 6-CL-HOBT;6-CHLOROBENZOTRIAZOLE-1-OL;6-CHLORO-N-HYDROXYBENZOTRIAZOL;6-Chloro-1-hydroxibenzotriazol;6-Chloro-1H-benzo[d][1,2,3]triazol-1-ol;Chloro-1-hydroxibenzotria;1-hydroxy-6-chlorobenzotriazoledihydrate;6-CHLORO-1-HYDROXY-1H-BENZOTRIAZOLE |
| CAS: | 26198-19-6 |
| MF: | C6H4ClN3O |
| MW: | 169.57 |
| EINECS: | 625-679-6 |
| Product Categories: | Peptide;Peptide Coupling Reagents;Miscellaneous |
| Mol File: | 26198-19-6.mol |
|
6-Chloro-1-hydroxibenzotriazol Chemical Properties
| Melting point | 197 °C |
| Boiling point | 379.5±34.0 °C(Predicted) |
| density | 1.71±0.1 g/cm3(Predicted) |
| Fp | 198°C |
| storage temp. | Store at R.T. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 6.69±0.58(Predicted) |
| form | Powder |
| Appearance | Off-white to light yellow Solid |
| Decomposition | 198 ºC |
| Stability: | Possibly Shock Sensitive |
| InChI | InChI=1S/C6H4ClN3O/c7-4-1-2-5-6(3-4)10(11)9-8-5/h1-3,11H |
| InChIKey | TZCYLJGNWDVJRA-UHFFFAOYSA-N |
| SMILES | N1(O)C2=CC(Cl)=CC=C2N=N1 |
| CAS DataBase Reference | 26198-19-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,E |
| Risk Statements | 22-44-36/37/38-20/21/22-2 |
| Safety Statements | 15-36-26-35 |
| RIDADR | UN 1325 4.1/PG 2 |
| HS Code | 29339980 |
6-Chloro-1-hydroxibenzotriazol Usage And Synthesis
| Chemical Properties | White powder |
| Uses | 1-Hydroxy-6-chlorobenzotriazole (Wetted with > 10% water) is used in preparation of Fusidic acid A cycloaminothiazole derivative. |
6-Chloro-1-hydroxibenzotriazol Preparation Products And Raw materials
