Introduction：Basic information about 6-Methoxy-2,3-dihydro-1H-indole CAS 7556-47-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-Methoxy-2,3-dihydro-1H-indole Basic information
| Product Name: | 6-Methoxy-2,3-dihydro-1H-indole |
| Synonyms: | 6-METHOXYINDOLINE;6-METHOXY-2,3-DIHYDRO-1H-INDOLE;1H-Indole,2,3-dihydro-6-Methoxy-;6-Methoxyindoline 6-Methoxy-2,3-dihydro-1H-indolein stock Factory;Chiglitazar Impurity 25;6-methoxyindoline - [M25238] |
| CAS: | 7556-47-0 |
| MF: | C9H11NO |
| MW: | 149.19 |
| EINECS: | |
| Product Categories: | Indoline & Oxindole |
| Mol File: | 7556-47-0.mol |
|
6-Methoxy-2,3-dihydro-1H-indole Chemical Properties
| Boiling point | 135-137 °C(Press: 14 Torr) |
| density | 1.076±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.96±0.20(Predicted) |
| Appearance | Light brown to brown Liquid |
| InChI | InChI=1S/C9H11NO/c1-11-8-3-2-7-4-5-10-9(7)6-8/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | GKFGHNMPMAXWQS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(OC)=C2)CC1 |
Safety Information
6-Methoxy-2,3-dihydro-1H-indole Usage And Synthesis
6-Methoxy-2,3-dihydro-1H-indole Preparation Products And Raw materials
| Raw materials | 4-Chloro-3-nitroanisole |
| Preparation Products | 6-Methoxyindole |
