Introduction：Basic information about Benzene,1,4-bis(1-methylethyl)-,homopolymer CAS 25822-43-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. Benzene,1,4-bis(1-methylethyl)-,homopolymer Basic information
- 2. Benzene,1,4-bis(1-methylethyl)-,homopolymer Chemical Properties
- 3. Safety Information
- 4. Benzene,1,4-bis(1-methylethyl)-,homopolymer Usage And Synthesis
- 5. Benzene,1,4-bis(1-methylethyl)-,homopolymer Preparation Products And Raw materials
Benzene,1,4-bis(1-methylethyl)-,homopolymer Basic information
| Product Name: | Benzene,1,4-bis(1-methylethyl)-,homopolymer |
| Synonyms: | Benzene,1,4-bis(1-methylethyl)-,homopolymer;Benzene,1,4-bis(1-methylethyl)-,hChemicalbookomopolymer;1,4-bis(1-methylethyl)-,homopolymer;Benzene,1,4-bis (1-methylethy1)-, homopolymer;polydicumyl |
| CAS: | 25822-43-9 |
| MF: | C12H18 |
| MW: | 162.28 |
| EINECS: | 449-400-0 |
| Product Categories: | |
| Mol File: | 25822-43-9.mol |
|
Benzene,1,4-bis(1-methylethyl)-,homopolymer Chemical Properties
| Melting point | ≈122~215℃ |
| Boiling point | >230℃ |
| density | 1.024[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| form | Flakes, Crystalline Powder, or Chunks |
| InChI | InChI=1S/C12H18/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-10H,1-4H3 |
| InChIKey | SPPWGCYEYAMHDT-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(C(C)C)=CC=1)(C)C |
| LogP | 9.2 at 30℃ |
Safety Information
Benzene,1,4-bis(1-methylethyl)-,homopolymer Usage And Synthesis
| Uses | Benzene,1,4-bis(1-methylethyl)-,homopolymer is an important polymer used as a grafting catalyst, polymer cross-linking initiator, engineering plastics modifier and flame retardant synergist. |
Benzene,1,4-bis(1-methylethyl)-,homopolymer Preparation Products And Raw materials
Benzene-1,2,3,4,5-d5, 6,6′,6′′-[(5-bromophenyl-2,3,4,6-d4)silylidyne]tris- CAS 2778147-35-4
