Introduction：Basic information about BETA-ASARONE CAS 5273-86-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BETA-ASARONE Basic information
| Product Name: | BETA-ASARONE |
| Synonyms: | (z)-1,2,4-trimethoxy-5-(1-propenyl)benzene;(Z)-5-Propenyl-1,2,4-trimethoxybenzene;(Z)-Asarone;2,4,5-Trimethoxy-1-propenylbenzene;2,4-trimethoxy-5-(1-propenyl)-(z)-benzen;2,4-trimethoxy-5-propenyl-(z)-benzen;Benzene, 1,2,4-trimethoxy-5-(1-propenyl)-, (Z)-;cis-β-Asarone (70%) |
| CAS: | 5273-86-9 |
| MF: | C12H16O3 |
| MW: | 208.25 |
| EINECS: | 226-096-6 |
| Product Categories: | Pharmaceutical intermediate |
| Mol File: | 5273-86-9.mol |
|
BETA-ASARONE Chemical Properties
| Boiling point | 296℃ |
| density | 1.073 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.558(lit.) |
| Fp | >230 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Colourless to Pale Yellow |
| BRN | 1910605 |
| Stability: | Light Sensitive |
| InChI | 1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5- |
| InChIKey | RKFAZBXYICVSKP-WAYWQWQTSA-N |
| SMILES | [H]\C(C)=C(/[H])c1cc(OC)c(OC)cc1OC |
| LogP | 3.406 (est) |
| CAS DataBase Reference | 5273-86-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | DC3000000 |
| HS Code | 29093090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | cyt-hmn-lym 107 mg/L PLMEAA 53,251,87 |
BETA-ASARONE Usage And Synthesis
| Chemical Properties | Crystals. Insoluble in water;soluble in alcohol. |
| Uses | Grain fumigant, insect chemisterilant. |
| Uses | cis-2,4,5-Trimethoxy-1-propenylbenzene (β-Asarone) was used in preparation of:
- 2,4,5-trimethoxycinnamaldehyde and 2,4,5-trimethoxycinnamyltosylhydrazone
- 1-(2,4,5-trimethoxyphenyl)-1,2-dihydroxypropane
|
| Uses | Reference standard in the analysis of herbal medicinal products. |
| Definition | ChEBI: The cis-isomer of asarone. |
| General Description | cis-2,4,5-Trimethoxy-1-propenylbenzene is an antibiotic and was isolated from the extract of Acorus gramineus using various chromatographic procedures. |
| Safety Profile | Questionable carcinogen withexperimental carcinogenic data reported. Human mutationdata reported. When heated to decomposition it emitsacrid smoke and irritating vapors. |
BETA-ASARONE Preparation Products And Raw materials
| Raw materials | alpha-Asarone |
| Preparation Products | BENZENE,1,2,4-TRIMETHOXY-5-(2-PROPENYL)- |
