Bis(tricyclohexylphosphine)palladium(II) Dichloride CAS 29934-17-6
Introduction：Basic information about Bis(tricyclohexylphosphine)palladium(II) Dichloride CAS 29934-17-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bis(tricyclohexylphosphine)palladium(II) Dichloride Basic information
| Product Name: | Bis(tricyclohexylphosphine)palladium(II) Dichloride |
| Synonyms: | TRANS-DICHLOROBIS-(TRICYCLOHEXYLPHOSPHINE)-PALLADIUM;TRANS-DICHLOROBIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II);trans-Dichlorobis(tricyclohexylphosphine)palladium(II),99%;dichlorobis(tricyclohexylphophine)palladium (ii);Dichlorobis(tricyclohexylphosphine)palladium(II), Pd 14.4%;BIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II) DICHLORIDE;DICHLOROBIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(II);dichloropalladium,tricyclohexylphosphane |
| CAS: | 29934-17-6 |
| MF: | C36H66Cl2P2Pd |
| MW: | 738.18 |
| EINECS: | 681-696-9 |
| Product Categories: | Pd (Palladium) Compounds;Synthetic Organic Chemistry;Transition Metal Compounds;Catalysis and Inorganic Chemistry;Homogeneous Pd Catalysts;metal-phosphine complexes;Catalysts for Organic Synthesis;Classes of Metal Compounds;Homogeneous Catalysts;Metal Complexes;Palladium;Pd |
| Mol File: | 29934-17-6.mol |
Bis(tricyclohexylphosphine)palladium(II) Dichloride Chemical Properties
| Melting point | 270 °C (dec.)(lit.) |
| density | 6.473 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Powder |
| color | Yellow |
| Water Solubility | Moderately soluble in dichloromethane and chloroform. Sparingly soluble in benzene and toluene. Insoluble in water, alcohols, acetone, diethyl ether, andhexanes. |
| InChI | InChI=1S/2C18H33P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*16-18H,1-15H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | KHXRPVIZRSHDNN-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.[Pd](Cl)Cl |
| CAS DataBase Reference | 29934-17-6 |
Safety Information
| Risk Statements | 22-36/37/38 |
| Safety Statements | 15-22-36/37/39-37/39-26 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Chemical Properties | Yellow powder |
| Uses | suzuki reaction |
| Uses | It is used as catalyst for C-C and C-N coupling reaction. It is used in the homogeneous carbonylation of chloroarenes under mild conditions. |
| Uses | Application Guide for Palladium Catalyzed Cross-Coupling Reactions |
| General Description | Dichlorobis(tricyclohexylphosphine)palladium(II) is widely employed as catalyst precursor in various carbon-carbon and carbon-heteroatom bond forming reactions. |
| reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| Synthesis | Bis(tricyclohexylphosphine)palladium(II) Dichloride is prepared by reacting Tricyclohexyl phosphine with Palladium chloride refluxed in acetone for 3h. |
Bis(tricyclohexylphosphine)palladium(II) Dichloride Preparation Products And Raw materials
| Raw materials | Tetrahydrofuran-->Dichloromethane-->Toluene-->Acetonitrile-->Magnesium-->Phosphorus trichloride-->Palladium chloride-->Bromocyclohexane-->Tricyclohexyl phosphine |
