Introduction:Basic information about CAS 393-82-8|2,5-Bis(trifluoromethyl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Bis(trifluoromethyl)benzoyl chloride |
|---|
| CAS Number | 393-82-8 | Molecular Weight | 276.56300 |
|---|
| Density | 1.528 g/mL at 25 °C(lit.) | Boiling Point | 185 |
|---|
| Molecular Formula | C9H3ClF6O | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 165 °F |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2,5-Bis(trifluoromethyl)benzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.528 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 185 |
|---|
| Molecular Formula | C9H3ClF6O |
|---|
| Molecular Weight | 276.56300 |
|---|
| Flash Point | 165 °F |
|---|
| Exact Mass | 275.97800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.10320 |
|---|
| Index of Refraction | n20/D 1.4315(lit.) |
|---|
| InChIKey | LRJNPOCQOZWIGR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(C(F)(F)F)ccc1C(F)(F)F |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| 2,5-trifluoromethylbenzoyl chloride |
| JRD-1676 |
| 2,5-bis-trifluoromethyl-benzoyl chloride |
| 2,4-DICHLORO-5-NITROBENZOTRIFLUORIDE |
| 2,5-Bis-trifluormethyl-benzoylchlorid |
| MFCD00074997 |