Introduction：Basic information about Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene CAS 149330-25-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene Basic information
| Product Name: | Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene |
| Synonyms: | 2,6-BIS-(BETA-HYDROXYETHYLAMINO)TOLUENE;2,6-bis[(2-hydroxyethyl)amino]toluene;2,2'-[(2-Methyl-1,3-phenylene)diimino]bis-ethanol;hc purple bs;BIS-2,6-N,N-(2-HYDROXYETHYL)DIAMINOTOLUENE;N,N-Di(2-hydroxyethyl)-2-methyl-1,3-phenylenediamine;2,6-di(2-hydroxyethylamino)toluene;2,2'-(2-Methyl-1,3-phenylene)bis(azanediyl)diethanol |
| CAS: | 149330-25-6 |
| MF: | C11H18N2O2 |
| MW: | 210.27 |
| EINECS: | |
| Product Categories: | Intermediates of Dyes and Pigments;Pharmaceutical Intermediates;Amines |
| Mol File: | 149330-25-6.mol |
|
Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene Chemical Properties
| Melting point | 117 °C |
| Boiling point | 463.5±40.0 °C(Predicted) |
| density | 1.217 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetonitrile (Slightly), DMSO (Slightly) |
| pka | 14.42±0.10(Predicted) |
| form | Solid |
| color | White to Light Grey |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C11H18N2O2/c1-9-10(12-5-7-14)3-2-4-11(9)13-6-8-15/h2-4,12-15H,5-8H2,1H3 |
| InChIKey | FGYCMSFOZIRDLN-UHFFFAOYSA-N |
| SMILES | C1(NCCO)=CC=CC(NCCO)=C1C |
| CAS DataBase Reference | 149330-25-6(CAS DataBase Reference) |
Safety Information
Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene Usage And Synthesis
| Chemical Properties | Off-white powder |
Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene Preparation Products And Raw materials
