Introduction：Basic information about Boc-Dap-OH CAS 73259-81-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Boc-Dap-OH Basic information
| Product Name: | Boc-Dap-OH |
| Synonyms: | N-Boc-beta-amino-L-alanine;(2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoic acid;N-alpha-L-(Butoxycarbonyl)-2,3-diaMinopropionic aci;3-Amino-N-(tert-butoxycarbonyl)-L-alanine 97%;3-Amino-Boc-L-alanin;Boc-Dapa-OH;3-AMINO-(TERT-BUTOXYCARBONYL)-L-ALANINE;Nα-Boc-L-2,3-diaminopropionic acid≥ 98% (HPLC) |
| CAS: | 73259-81-1 |
| MF: | C8H16N2O4 |
| MW: | 204.22 |
| EINECS: | 1533716-785-6 |
| Product Categories: | Amino Acids |
| Mol File: | 73259-81-1.mol |
|
Boc-Dap-OH Chemical Properties
| Melting point | 210 °C (dec.) |
| alpha | -5.5 º (c=1, acetic acid) |
| Boiling point | 364.4±37.0 °C(Predicted) |
| density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Heated, Sonicated), Water (Sparingly, Heated, Sonicated) |
| pka | 2.88±0.16(Predicted) |
| form | Solid |
| color | White to Off-White |
| Optical Rotation | [α]20/D +5.5±1°, c = 1% in methanol: water (1:1) |
| BRN | 4182136 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H16N2O4/c1-8(2,3)14-7(13)10-5(4-9)6(11)12/h5H,4,9H2,1-3H3,(H,10,13)(H,11,12)/t5-/m0/s1 |
| InChIKey | KRJLRVZLNABMAT-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CN)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 73259-81-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
Boc-Dap-OH Usage And Synthesis
| Chemical Properties | White powder |
| Uses | Reactant for:
- Protein assembly directed by synthetic molecular recognition motifs
- Solid phase synthesis of gramicidin S cyclic analogs with antibiotic and hemolytic activities
- Synthesis of HCV protease inhibitor modified analogs
- Solid phase synthesis of peptidic V1a receptor agonists
- Directed peptide assembly at lipid-water interface
|
| Uses | (S)-3-amino-2-(tert-Butoxycarbonylamino)propionic acid (Boc-Dap-OH) is a derivative of amino acids, mainly used as an intermediate in organic synthesis and pharmaceutical chemistry, and can be used in the synthesis of peptide drug molecules and bioactive molecules. |
| Definition | Boc-Dap-OH is an amino acid molecule that is a zwitterion. Therefore, the addition of a base is required to prepare a nucleophilic amino acid. It is commonly acts as a nucleophile to attack the acyl carbon.
|
| Preparation | The raw material was dissolved inabsolute ethanol (5 mL), and the reaction flask was immersed in a water bath at 25 C. To the alcoholicsolution, 10% palladium-carbon (22.9 mg) and 1,4-cyclohexadiene (10 equivalents with respect to4; 0.47 mL, 5.0 mmol) were added, and the mixture was allowed to react under magnetic stirringovernight. After filtration over a short pad of Celite 545, the solvent was evaporated under reducedpressure conditions, and the solid residue was partitioned in a 1:1 (v/v) H2O/EtOAc mixture (10 mL).The aqueous phase was separated, back extracted with EtOAc (3 10 mL), concentrated under reducedpressure conditions, and lyophilized.Finally, the target product Boc-Dap-OH is obtained.
|
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
Boc-Dap-OH Preparation Products And Raw materials
