Introduction：Basic information about Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH CAS 1169630-31-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH Basic information
| Product Name: | Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH |
| Synonyms: | Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH;Glycine, N,1-bis[(1,1-dimethylethoxy)carbonyl]-L-histidyl-2-methylalanyl-L-α-glutamyl-, 3-(1,1-dimethylethyl) ester |
| CAS: | 1169630-31-2 |
| MF: | C31H50N6O11 |
| MW: | 682.76 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1169630-31-2.mol |
|
Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH Chemical Properties
| density | 1.25±0.1 g/cm3(Predicted) |
| pka | 3.30±0.10(Predicted) |
| InChIKey | FNXPUMYXFQQETO-PMACEKPBSA-N |
| SMILES | [C@@H](NC(=O)OC(C)(C)C)(C(=O)NC(C)(C)C(=O)N[C@H](C(=O)NCC(=O)O)CCC(=O)OC(C)(C)C)CC1N=CN(C=1)C(=O)OC(C)(C)C |
Safety Information
Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH Usage And Synthesis
Boc-His(Boc)-Aib-Glu(OtBu)-Gly-OH Preparation Products And Raw materials
