Introduction：Basic information about BODIPY 581/591 carboxylic acid CAS 480999-04-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BODIPY 581/591 carboxylic acid Basic information
| Product Name: | BODIPY 581/591 carboxylic acid |
| Synonyms: | BODIPY 581/591 carboxylic acid;BDP 581/591 carboxylic acid;BODIPY 581/591 carboxylic acid/COOH;BDP 581/591 acid;BDP 581(E&Z);BDP581 |
| CAS: | 480999-04-0 |
| MF: | C22H19BF2N2O2 |
| MW: | 392.21 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 480999-04-0.mol |
|
BODIPY 581/591 carboxylic acid Chemical Properties
| solubility | Soluble in DMF, DMSO, DCM |
| Appearance | dark powder |
| InChI | InChI=1S/C22H19BF2N2O2/c24-23(25)26-18(9-5-4-8-17-6-2-1-3-7-17)10-12-20(26)16-21-13-11-19(27(21)23)14-15-22(28)29/h1-13,16H,14-15H2,(H,28,29) |
| InChIKey | BNURWCMGIJOEAC-UHFFFAOYSA-N |
| SMILES | [F-][B+3]1(N2=C(C=CC2=CC2=CC=C(CCC(=O)[O-])[N-]12)C=CC=CC1C=CC=CC=1)[F-].[H+] |
Safety Information
BODIPY 581/591 carboxylic acid Usage And Synthesis
| Description | BDP 581/591 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 581/591 is very photostable. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
| Uses | BDP 581/591 carboxylic acid is a fluorescent dye (Ex=585 nm, Em=594 nm). BDP 581/591 carboxylic acid has a free carboxylic acid group, which can be catalyzed by a catalyst (such as EDC or HATU) to react with primary amines to form stable amide bonds. BDP 581/591 carboxylic acid is highly photostable and can be used for ROS detection. |
| Abs/Em Maxima | 585/594 nm |
| Fluoresene quantum yield | 0.83 |
| Extinction Coefficient | 104000 |
| CF260 | 0.06 |
| CF280 | 0.04 |
BODIPY 581/591 carboxylic acid Preparation Products And Raw materials
