Introduction：Basic information about caramiphen CAS 77-22-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
caramiphen Basic information
| Product Name: | caramiphen |
| Synonyms: | caramiphen;1-(2-Diethylaminoethoxycarbonyl)-1-phenylcyclopentane;1-Phenyl-1-cyclopentanecarboxylic acid 2-(diethylamino)ethyl;1-Phenyl-1-cyclopentanecarboxylic acid 2-(diethylamino)ethyl ester;Pentaphen【pharmaceutical】;1-phenylcyclopentanecarboxylic acid 2-diethylaminoethyl ester;2-diethylaminoethyl 1-phenylcyclopentane-1-carboxylate;2-(Diethylamino)ethyl 1-phenylcyclopentanecarboxylate |
| CAS: | 77-22-5 |
| MF: | C18H27NO2 |
| MW: | 289.41 |
| EINECS: | 201-013-6 |
| Product Categories: | API |
| Mol File: | 77-22-5.mol |
|
caramiphen Chemical Properties
| Boiling point | bp0.07 112-115° |
| storage temp. | 2-8°C |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H27NO2/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey | OFAIGZWCDGNZGT-UHFFFAOYSA-N |
| SMILES | N(CCOC(=O)C2(CCCC2)c1ccccc1)(CC)CC |
Safety Information
caramiphen Usage And Synthesis
| Chemical Properties | Liquid. Boiling point: 156-158°C (0.93 kPa), 110-115°C (6.65×10-3 kPa). |
| Uses | Pentoxyverine impurity B EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| Definition | ChEBI: Caramiphen is a member of benzenes. |
| Synthesis Reference(s) | Canadian Journal of Chemistry, 40, p. 1909, 1962 DOI: 10.1139/v62-293 |
caramiphen Preparation Products And Raw materials
| Raw materials | Diethylaminoethanol-->α-Phenylcyclopentanecarbonyl chloride |
