Introduction：Basic information about CEFATHIAMIDINE CAS 33075-00-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CEFATHIAMIDINE Basic information
| Product Name: | CEFATHIAMIDINE |
| Synonyms: | CEFATHIAMIDINE;5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid, 7-(2-((n,n'-diisopropyla;7-(2-((n,n'-diisopropylamidino)thio)acetamido)-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic aci acetate;7-(alpha-((n,n'-diisopropylamidino)thio)acetylamino)cephalosporanic acid;(6R,7R)-3-(acetyloxymethyl)-7-[[2-[N,N'-di(propan-2-yl)carbamimidoyl]sulfanylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;(6R)-3-[(Acetyloxy)methyl]-7α-[2-[(N,N'-diisopropylamidino)thio]acetylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;7-[α-[(N,N'-Diisopropylamidino)thio]acetylamino]cephalosporanic acid;(6R,7R)-3-(acetoxymethyl)-7-(2-(((E)-N,N'-diisopropylcarbamimidoyl)thio)acetamido)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| CAS: | 33075-00-2 |
| MF: | C19H28N4O6S2 |
| MW: | 472.58 |
| EINECS: | 278-355-8 |
| Product Categories: | |
| Mol File: | 33075-00-2.mol |
|
CEFATHIAMIDINE Chemical Properties
| Melting point | >140°C (dec.) |
| density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.67±0.50(Predicted) |
| color | White to Off-White |
| Stability: | Unstable in Solution |
| InChIKey | JYXACOFERDBGGQ-RHSMWYFYSA-N |
| SMILES | N12[C@@]([H])([C@H](NC(CSC(NC(C)C)=NC(C)C)=O)C1=O)SCC(COC(C)=O)=C2C(O)=O |
Safety Information
CEFATHIAMIDINE Usage And Synthesis
| Chemical Properties | Off-White Solid |
| Uses | Cefathiamidine is an antibacterial agent that exhibits a broad spectrum of bactericidal activity against gram-positive bacteria. |
| Definition | ChEBI: Cefathiamidine is a cephalosporin. |
| in vivo | Cefathiamidine is not absorbed orally and is, thus, administered through the parenteral route (intravenously or intramuscularly). Cefathiamidine is widely distributed in most bodily fluids and tissues; however, Cefathiamidine cannot pass through the blood-brain barrier. The protein-binding capacity of Cefathiamidine is 23%, and more than 90% of Cefathiamidine is excreted unchanged by the kidney[1]. |
| IC 50 | β-lactam |
CEFATHIAMIDINE Preparation Products And Raw materials
| Raw materials | Thiourea, N,N-bis(1-methylethyl)--->7-(ALPHA-BROMOACETAMIDO)CEPHALOSPORANIC ACID-->Cefathiamidine Impurity 6-->N,N'-DIISOPROPYLTHIOUREA-->7-Aminocephalosporanic acid |
