Introduction:Basic information about CURCULIGOSIDE CAS 85643-19-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CURCULIGOSIDE Basic information
| Product Name: | CURCULIGOSIDE |
| Synonyms: | CURCULIGOSIDE;[5-Hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl-2,6-dimethoxybenzoate;Curculigoside, 98%, from Curculigo orchioides Gaertn.;CurculigosideA;β-D-Glucopyranoside,2-[[(2,6-diMethoxybenzoyl)oxy]Methyl]-4-hydroxyphenyl;β-D-Glucopyranoside, 2-[[(2,6-dimethoxybenzoyl)oxy]methyl]-4-hydroxyphenyl;2-[[(2,6-Dimethoxybenzoyl)oxy]methyl]-4-hydroxyphenyl beta-D-Glucopyranoside;Curculigoside, 10 mM in DMSO |
| CAS: | 85643-19-2 |
| MF: | C22H26O11 |
| MW: | 466.44 |
| EINECS: | |
| Product Categories: | Miscellaneous Natural Products;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract |
| Mol File: | 85643-19-2.mol |
|
CURCULIGOSIDE Chemical Properties
| Melting point | 158-160 °C(Solv: methanol (67-56-1)) |
| Boiling point | 734.9±60.0 °C(Predicted) |
| density | 1.450±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Methanol (Slightly) |
| form | Solid |
| pka | 9.70±0.20(Predicted) |
| color | Off-White |
| Water Solubility | sparingly soluble in water |
| InChIKey | SJJRKHVKAXVFJQ-SPHHHMSGNA-N |
| SMILES | C(C1C(=CC=CC=1OC)OC)(=O)OCC1C=C(O)C=CC=1O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:22,23,24,26,28,r| |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
CURCULIGOSIDE Usage And Synthesis
| Chemical Properties | White granular crystals, easily soluble in methanol, almost insoluble in ether, derived from Curculigo. |
| Uses | Curculigoside induces angiogenesis through Vcam-1/Egr-3/CREB/VEGF signal pathway. May aid in protecting the brain against injury. In addition it improves osteogenesis of human amniotic fluid derived stem cells. |
CURCULIGOSIDE Preparation Products And Raw materials