D-beta- Tocotrienol CAS 490-23-3
Introduction：Basic information about D-beta- Tocotrienol CAS 490-23-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-beta- Tocotrienol Basic information
| Product Name: | D-beta- Tocotrienol |
| Synonyms: | (2R)-3,4-Dihydro-2,5,8-triMethyl-2-[(3E,7E)-4,8,12-triMethyl-3,7,11-tridecatrien-1-yl]-2H-1-benzopyran-6-ol;2,5,8-TriMethyl-2-(4,8,12-triMethyl-3,7,11-tridecatrienyl)-6-chroManol;D-beta- Tocotrienol;3,4-dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-trideca-3,7,11-trienyl)-2H-1-benzopyran-6-ol;tocotrienol, beta;[R-(E,E)]-3,4-Dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-2H-1-benzopyran-6-ol;3,4-Dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-2H-1-benzopyran-6-ol;5-Methyltocol |
| CAS: | 490-23-3 |
| MF: | C28H42O2 |
| MW: | 410.63 |
| EINECS: | 207-708-0 |
| Product Categories: | Aromatics;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 490-23-3.mol |
D-beta- Tocotrienol Chemical Properties
| Melting point | <25℃ |
| Boiling point | 528.8±49.0 °C(Predicted) |
| density | 0.964±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 10 mg/ml |
| pka | 11.05±0.40(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| biological source | Elaeis guineensis |
| Major Application | vitamins, nutraceuticals, and natural products |
| InChIKey | FGYKUFVNYVMTAM-WAZJVIJMSA-N |
| SMILES | [C@@]1(C)(CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/C)OC2=C(C)C=C(O)C(C)=C2CC1 |
| LogP | 10.300 (est) |
| EPA Substance Registry System | .epsilon.-Tocopherol (490-23-3) |
Safety Information
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Uses | β-Tocotrienol is an isomer of Vitamin E. β-Tocotrienol is one of the naturally occurring forms of vitamin E. β-Tocotrienol was isolated from wheat germ oil and from bran. |
| Definition | ChEBI: A tocotrienol that is chroman-6-ol substituted by methyl groups at positions 2, 5 and 8 and a farnesyl chain at position 2. It has been isolated from various cultivars of wheat. |
D-beta- Tocotrienol Preparation Products And Raw materials
