Introduction：Basic information about D-Histidine CAS 351-50-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-Histidine Basic information
| Product Name: | D-Histidine |
| Synonyms: | H-D-HIS-OH;HISTIDINE, D-;D-ALPHA-AMINO-BETA-IMIDAZOLEPROPIONIC ACID;D-ALPHA-AMINO-BETA-(4-IMIDAZOLYL)PROPIONIC ACID;D-2-AMINO-3-(4-IMIDAZOLYL)PROPIONIC ACID;D-HIS-OH;D-HISTIDINE;D-HIS |
| CAS: | 351-50-8 |
| MF: | C6H9N3O2 |
| MW: | 155.15 |
| EINECS: | 206-513-8 |
| Product Categories: | amino acid;Amino Acids;Biochemistry;Amino Acids;Amino Acid Derivatives;Histidine [His, H];Amino Acids and Derivatives;alpha-Amino Acids |
| Mol File: | 351-50-8.mol |
|
D-Histidine Chemical Properties
| Melting point | 280 °C |
| alpha | -12 º (c=11, 6N HCl) |
| Boiling point | 278.95°C (rough estimate) |
| density | 1.3092 (rough estimate) |
| refractive index | -13 ° (C=11, 6mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 1 M HCl: soluble |
| pka | 1.91±0.10(Predicted) |
| form | Free-Flowing Powder |
| color | White |
| Optical Rotation | 37.9°(C=1.00g/100mL H2O) |
| Water Solubility | 42 g/L (25 ºC) |
| Merck | 14,4720 |
| BRN | 84089 |
| Stability: | Hygroscopic |
| Major Application | detection
peptide synthesis |
| InChI | 1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 |
| InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-N |
| SMILES | N[C@H](Cc1c[nH]cn1)C(O)=O |
| LogP | -1.270 |
| CAS DataBase Reference | 351-50-8(CAS DataBase Reference) |
| EPA Substance Registry System | D-Histidine (351-50-8) |
Safety Information
| Hazard Codes | Xn |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
D-Histidine Usage And Synthesis
| Chemical Properties | white crystalline powder |
| Uses | D-Histidine is the unnatural, biologically inactive isomer of L-Histidine (H456010). D-histidine is known to inhibit cell division, and is also used by certain types of bacteria (such as Escherichia coli) as a source of L-Histidine. |
| Definition | ChEBI: An optically active form of histidine having D-configuration. |
| Biochem/physiol Actions | D-Histidine may be used in the design of peptide drugs, cationic peptides, such as analogues of carnosine. D-Histidine may also be used as a heavy metal sequestration agent. |
D-Histidine Preparation Products And Raw materials
| Preparation Products | L-Histidine hydrochloride-->L-Carnosine-->(R)-(+)-2-Chloro-3-[4(5)-imidazolyl]propionic Acid |
