Introduction：Basic information about Dicentrin CAS 517-66-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dicentrin Basic informationDescription Anti-cancer Activity
| Product Name: | Dicentrin |
| Synonyms: | DICENTRINE95%;dicentrine;(7aS)-6,7,7a,8-Tetrahydro-10,11-dimethoxy-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline;1,2-Methylenedioxy-9,10-dimethoxyaporphine;5H-Benzo[G]-1,3-benzodioxolo[6,5,4-de]quinoline, 6,7,7A,8-tetrahydro-10,11-dimethoxy-7-methyl-, (S)-;6A.alpha.-Aporphine, 9,10-dimethoxy-1,2-(methylenedioxy)-;9,10-Dimethoxy-1,2-(methylenedioxy)aporphine;Nsc406035 |
| CAS: | 517-66-8 |
| MF: | C20H21NO4 |
| MW: | 339.39 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 517-66-8.mol |
|
Dicentrin Chemical Properties
| Melting point | 177-178℃ |
| Boiling point | 481℃ |
| density | 1.266 |
| refractive index | 1.6250 (estimate) |
| Fp | 143℃ |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in DMSO |
| pka | 6.65±0.20(Predicted) |
| form | Solid |
| color | Off-white to light brown |
| InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | YJWBWQWUHVXPNC-AWEZNQCLSA-N |
| SMILES | N1(C)[C@]2([H])C3=C(C4=C(C=C3CC1)OCO4)C1=CC(OC)=C(OC)C=C1C2 |
Safety Information
Dicentrin Usage And Synthesis
| Description | D-Dicentrine is an aporphinic alkaloid found in several plant species, mainly from family Lauraceae, including Lindera megaphylla. D-Dicentrine shows antinociceptive activity in a mouse model of pain. It probably acts via a TRPA1-dependent mechanism. D-Dicentrine is an alpha 1-adrenoceptor antagonist effective against human hyperplastic prostates. |
| Anti-cancer Activity | D-Dicentrine, a naturally occurring aporphine type isoquinoline alkaloid, isolated from the root of Lindera megaphylla Hemsl. (Lauraceae), was evaluated for its potential anti-cancer activity. Huang RL etc. found d-dicentrine significantly inhibited the growth of human hepatoma cell line HuH-7 by delaying its doubling time in tissue culture. An in vitro colony forming assay showed that d-dicentrine decreased the colony formation efficiency in both hepatoma cell lines, HuH-7 and MS-G2, used in our study. |
| Uses | d-Dicentrine is a natural aporphine alkaloid extracted from the root of L. megaphylla which displays antitumor effects through inhibition of topoisomerase II. |
| Definition | ChEBI: Dicentrine is an aporphine alkaloid. |
| IC 50 | α adrenergic receptor |
Dicentrin Preparation Products And Raw materials
