Introduction：Basic information about Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate CAS 976-56-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Basic information
| Product Name: | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate |
| Synonyms: | Diethyl3,5-di-tert-buty-4-hydroxy-ben-zylphosphonate;Irganox1222;Phosphonicacid,[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-,diethylester;[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-phosphonicacidiethyl;diethyl 4-hydroxy-3,5-di-tert-butylbenzylphosphonate;3,5-DI-TERT-BUTYL-4-HYDROXYBENZYLPHOSPHONIC ACID DIETHYL ESTER;diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate;DIETHYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZYLPHOSPHONATE |
| CAS: | 976-56-7 |
| MF: | C19H33O4P |
| MW: | 356.44 |
| EINECS: | 213-551-9 |
| Product Categories: | |
| Mol File: | 976-56-7.mol |
|
Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Chemical Properties
| Melting point | 122 °C |
| Boiling point | 417.0±33.0 °C(Predicted) |
| density | 1.046±0.06 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| pka | 12.04±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 14mg/L at 20℃ |
| InChI | InChI=1S/C19H33O4P/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8/h11-12,20H,9-10,13H2,1-8H3 |
| InChIKey | GJDRKHHGPHLVNI-UHFFFAOYSA-N |
| SMILES | P(CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(=O)(OCC)OCC |
| LogP | 2.9 at 23℃ |
| CAS DataBase Reference | 976-56-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonic acid, [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-, diethyl ester (976-56-7) |
Safety Information
| Hazard Codes | Xi |
| TSCA | TSCA listed |
| HS Code | 2920.90.2000 |
Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Usage And Synthesis
| Flammability and Explosibility | Not classified |
Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Preparation Products And Raw materials
| Raw materials | Dimethylamine-->Diethyl phosphite-->N,N-Dimethylbenzylamine-->2,6-Di-tert-butylphenol |
| Preparation Products | Phosphonic acid, P-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]- |
