Introduction：Basic information about DIETHYL AZELATE CAS 624-17-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DIETHYL AZELATE Basic information
| Product Name: | DIETHYL AZELATE |
| Synonyms: | DIETHYL AZELATE;AKOS 223-29;Azelaic acid, diethyl ester;Diethyl azelaate;Diethyl nonanedioate;Nonanedioic acid, diethyl ester;Nonanedioicacid,diethylester;nonanedioicaciddiethylester |
| CAS: | 624-17-9 |
| MF: | C13H24O4 |
| MW: | 244.33 |
| EINECS: | 210-833-3 |
| Product Categories: | Plasticizers;Polymer Additives;Polymer Science |
| Mol File: | 624-17-9.mol |
|
DIETHYL AZELATE Chemical Properties
| Melting point | -16--15.8 °C (lit.) |
| Boiling point | 172 °C/18 mmHg (lit.) |
| density | 0.973 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.435(lit.) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| Dielectric constant | 5.0（Ambient） |
| InChI | InChI=1S/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
| InChIKey | CQMYCPZZIPXILQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCCCCC(OCC)=O |
| LogP | 3.318 (est) |
| CAS DataBase Reference | 624-17-9(CAS DataBase Reference) |
| EPA Substance Registry System | Nonanedioic acid, diethyl ester (624-17-9) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
DIETHYL AZELATE Usage And Synthesis
| Uses | Diethyl azelate (DEA) is a plasma membrane fluidiser with broad immunomodulatory activity for the treatment of brown recluse spider bites. Topical application of DEA eliminates the sequelae of brown recluse spider poisoning in humans within two weeks. In vitro, DEA inhibits brown recluse spider venom and rPLD-induced haemolysis, and inhibits phospholipase A2 activity in a dose-dependent manner. |
DIETHYL AZELATE Preparation Products And Raw materials
| Preparation Products | Azelaic Acid Monoethyl Ester |
