Introduction：Basic information about Diethyl sulfite CAS 623-81-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diethyl sulfite Basic information
| Product Name: | Diethyl sulfite |
| Synonyms: | SULFUROUS ACID DIETHYL ESTER;(C2H5O)2SO;Diethyl ester of sulfurous acid;Diethyl sulphite;Ethyl sulfite, (Et2SO3);Ethylethylsulfonate;Sulphurous acid diethyl ester;tl158 |
| CAS: | 623-81-4 |
| MF: | C4H10O3S |
| MW: | 138.19 |
| EINECS: | 210-815-5 |
| Product Categories: | Organic Building Blocks;Organic Sulfates/Sulfites;Sulfur Compounds |
| Mol File: | 623-81-4.mol |
|
Diethyl sulfite Chemical Properties
| Boiling point | 158-160 °C(lit.) |
| density | 1.077 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.414(lit.) |
| Fp | 129 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| BRN | 1701906 |
| Dielectric constant | 15.9（20℃） |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C4H10O3S/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| InChIKey | NVJBFARDFTXOTO-UHFFFAOYSA-N |
| SMILES | S(OCC)(OCC)=O |
| CAS DataBase Reference | 623-81-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfurous acid, diethyl ester(623-81-4) |
| EPA Substance Registry System | Sulfurous acid, diethyl ester (623-81-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-24/25-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | WT3511000 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29209085 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
Diethyl sulfite Usage And Synthesis
| Chemical Properties | clear colorless solution |
| Uses | Diethyl sulfite (DES) is used as a film forming and high temperature additive for electrolytes in lithium ion batteries. It improves decomposition resistance of the electrolyte. Diethyl sulfite is also used as solvent for lithium bis(oxalato)borate (LiBOB) based electrolytes. The LiBOB-based electrolyte with DES shows high oxidation potentials, and good conductivities. |
| General Description | This product has been enhanced for energy efficiency. |
Diethyl sulfite Preparation Products And Raw materials
| Preparation Products | 1,1-Diethoxybutane-->CINNAMALDEHYDE DIETHYL ACETAL |
