Introduction：Basic information about Diethylaminopropyne formate CAS 125678-52-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diethylaminopropyne formate Basic information
| Product Name: | Diethylaminopropyne formate |
| Synonyms: | 3-N,N-Diethylamino-1-propyne formate;Diethylamino-2-propyne, sulfate;PABS;diethylaminopropyne formate;DIETHYLAMINOPROPYNE FORMIC ACID;DiethylaMinopropyne forMate (PABS);PABS(DiethylaMinopropyne forMate);PABS(Diethylamino-2-propyne, sulfate) |
| CAS: | 125678-52-6 |
| MF: | C8H15NO2 |
| MW: | 157.21 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 125678-52-6.mol |
|
Diethylaminopropyne formate Chemical Properties
| density | 1.04 |
| refractive index | 1.4190-1.4320 |
| storage temp. | Stored in cool and dry place |
| form | Liquid |
| color | Yellowish to brownish yellow |
| PH | 4.0~5.0 |
| Water Solubility | Well soluble in water (20oC) |
| InChI | InChI=1S/C7H13N.CH2O2/c1-4-7-8(5-2)6-3;2-1-3/h1H,5-7H2,2-3H3;1H,(H,2,3) |
| InChIKey | FZMMJXJELVVLLB-UHFFFAOYSA-N |
| SMILES | C(#C)CN(CC)CC.C(O)=O |
Safety Information
Diethylaminopropyne formate Usage And Synthesis
| Uses | Diethylaminopropyne formate(PABS) can be used as an intermediate of electroplating additive to prepare nickel plating brightening agent. |
Diethylaminopropyne formate Preparation Products And Raw materials
