Diphenylphosphinic Chloride CAS 1499-21-4
Introduction：Basic information about Diphenylphosphinic Chloride CAS 1499-21-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diphenylphosphinic Chloride Basic information
| Product Name: | Diphenylphosphinic Chloride |
| Synonyms: | Diphenyl phosphilic chloride;Diphenylphoshinic;DIPHENYLPHOSHINIC CHLORIDE;Diphenylchlorophosphine oxide;Diphenylphosphinyl chloride,98%;(Chloro-phenylphosphoryl)benzene;Diphenylphosphinic acid chloride;Diphenylphosphinicchloride,98% |
| CAS: | 1499-21-4 |
| MF: | C12H10ClOP |
| MW: | 236.63 |
| EINECS: | 216-107-2 |
| Product Categories: | Biochemistry;Coupling Reactions (Peptide Synthesis);Peptide Synthesis;Protection & Derivatization Reagents (for Synthesis);Reagents for Oligosaccharide Synthesis;Synthetic Organic Chemistry;Phosphorus compounds;Pharmaceutical Intermediates;organophosphorus compound;Morpholines/Thiomorpholines |
| Mol File: | 1499-21-4.mol |
Diphenylphosphinic Chloride Chemical Properties
| Melting point | 20°C |
| Boiling point | 222 °C/16 mmHg (lit.) |
| density | 1.24 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 79 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, methanol |
| form | Liquid |
| Specific Gravity | 1.24 |
| color | Clear colorless to yellow |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 975191 |
| InChI | 1S/C12H10ClOP/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | QPQGTZMAQRXCJW-UHFFFAOYSA-N |
| SMILES | ClP(=O)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 1499-21-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylphosphinic chloride(1499-21-4) |
Safety Information
| Hazard Codes | C,F |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable/Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B Skin Sens. 1A |
| Chemical Properties | clear colorless to yellow liquid |
| Uses | Diphenylphosphinic chloride (Ph2POCl) is widely used as a precursor to synthesize various chiral phosphine bidentate ligands for asymmetric synthesis, in addition to several peptide coupling agents. |
| Application | Diphenylphosphinic chloride is a reagent that is used in the synthesis of bidentate ligands and peptide coupling agents. It is used as flame retardants. It also act as pharmaceutical adjuvant. |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling |
| Synthesis | To an oven-dried 100 mL, a two-necked flask fitted with a reflux condenser was added Et2O (depending on the Grignard reagent solution's concentration) and POCl3. The solution was cooled in an ice-salt mixture, and a Grignard reagent solution in Et2O was slowly added. After stirring with cooling for 30 min, the reaction mixture was brought to rt and stirred for the indicated time. The mixture was then cooled in an ice-salt mixture, and the alcohol and pyridine were slowly added. Stirring with cooling for 5 min was followed by reaction at rt. The reaction was quenched after the indicated time by cooling in an ice-salt mixture and adding sat aq NH4Cl. The crude mixture was then poured into CH2Cl2, washed three times with HCl, dried, filtered, and evaporated to dryness. The excess alcohol was removed using a short-path vacuum distillation apparatus, and the resulting crude product Diphenylphosphinic Chloride was purified by column chromatography. |
Diphenylphosphinic Chloride Preparation Products And Raw materials
| Preparation Products | 4-Methoxyphenyldiphenylphosphine oxide-->N-(diphenylphosphoryl)-P,P-diphenylphosphinic amide |
