Introduction:Basic information about Di-p-toluoyl-D-tartaric acid monohydrate CAS 71607-32-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Di-p-toluoyl-D-tartaric acid monohydrate Basic information
| Product Name: | Di-p-toluoyl-D-tartaric acid monohydrate |
| Synonyms: | DI-P-TOLUOYL-D-TARTARIC ACID MONOHYDRATE;L-(-)-DI-P-TOLUOYL-D-TARTARIC ACID MONOHYDRATE;(2S,3S)-2,3-BIS-(4-METHYL-BENZOYLOXY)-SUCCINIC ACID MONOHYDRATE;Di-p-Toluoyl-D-Trataric Acid Monohydrate;DL-p-Toluoyl-L-tartaricacidmonohydrate;DL-p-Toluoyl-D-tartaricacidmonohydrate;DI-4-TOLUOYL-D-TARTARICACID1-HYDRATE;(2R,3R)-2,3-bis(4-methylbenzoyloxy)succinic acid h |
| CAS: | 71607-32-4 |
| MF: | C20H20O9 |
| MW: | 404.37 |
| EINECS: | 1533716-785-6 |
| Product Categories: | Chiral Compound;FINE Chemical & INTERMEDIATES;Miscellaneous Biochemicals;chiral;API intermediates;CHIRAL CHEMICALS;Hydroxy Acids & Deriv. |
| Mol File: | 71607-32-4.mol |
|
Di-p-toluoyl-D-tartaric acid monohydrate Chemical Properties
| Melting point | 163-165 °C(lit.) |
| alpha | 140 º (c=1, MeoH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White |
| Optical Rotation | Consistent with structure |
| InChI | InChI=1/C20H18O8.H2O/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);1H2/t15-,16-;/s3 |
| InChIKey | FOTRUJUPLHRVNU-VAOSCPPKNA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C(O)=O)OC(=O)C1=CC=C(C)C=C1)OC(=O)C1=CC=C(C)C=C1.[H]O[H] |&1:3,4,r| |
| CAS DataBase Reference | 71607-32-4(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29181990 |
Di-p-toluoyl-D-tartaric acid monohydrate Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | Di-p-toluoyl-d-tartaric Acid Monohydrate is a useful intermediate in the preparation of chiral rivastigmine hydrogen tartrate. |
Di-p-toluoyl-D-tartaric acid monohydrate Preparation Products And Raw materials